EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65887 - eurycomanone
| Formula | C20H24O9 |
| Net Charge | 0 |
| Average Mass | 408.403 |
| Monoisotopic Mass | 408.14203 |
| SMILES | [H][C@]12[C@@]3(C)[C@H](O)C(=O)C=C(C)[C@]3([H])C[C@@]3([H])OC(=O)[C@H](O)[C@@]4(O)C(=C)[C@@H](O)[C@@]1(O)OC[C@]234 |
| InChI | InChI=1S/C20H24O9/c1-7-4-10(21)13(23)17(3)9(7)5-11-18-6-28-20(27,16(17)18)12(22)8(2)19(18,26)14(24)15(25)29-11/h4,9,11-14,16,22-24,26-27H,2,5-6H2,1,3H3/t9-,11+,12+,13+,14-,16+,17+,18+,19-,20+/m0/s1 |
| InChIKey | UCUWZJWAQQRCOR-AIMGAIMTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eurycoma longifolia (ncbitaxon:458531) | root (BTO:0001188) | PubMed (1800638) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eurycomanone (CHEBI:65887) has role antimalarial (CHEBI:38068) |
| eurycomanone (CHEBI:65887) has role antineoplastic agent (CHEBI:35610) |
| eurycomanone (CHEBI:65887) has role metabolite (CHEBI:25212) |
| eurycomanone (CHEBI:65887) is a cyclic ether (CHEBI:37407) |
| eurycomanone (CHEBI:65887) is a enone (CHEBI:51689) |
| eurycomanone (CHEBI:65887) is a organic heteropentacyclic compound (CHEBI:38164) |
| eurycomanone (CHEBI:65887) is a pentol (CHEBI:37205) |
| eurycomanone (CHEBI:65887) is a quassinoid (CHEBI:72485) |
| eurycomanone (CHEBI:65887) is a secondary alcohol (CHEBI:35681) |
| eurycomanone (CHEBI:65887) is a secondary α-hydroxy ketone (CHEBI:2468) |
| eurycomanone (CHEBI:65887) is a tertiary alcohol (CHEBI:26878) |
| eurycomanone (CHEBI:65887) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1β,11β,12α,15β)-1,11,12,14,15-pentahydroxy-11,20-epoxypicrasa-3,13(21)-diene-2,16-dione |
| Synonyms | Source |
|---|---|
| Pasakbumin-A | ChemIDplus |
| Picrasa-3,13(21)-diene-2,16-dione,11,2O-epoxy-1,11,12,14,15-pentahydroxy-,(1beta,11beta,12alpha,15beta)-,dihydrate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3635742 | Reaxys |
| CAS:84633-29-4 | ChemIDplus |
| Citations |
|---|