EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H46O10 |
| Net Charge | 0 |
| Average Mass | 626.743 |
| Monoisotopic Mass | 626.30910 |
| SMILES | [H][C@@]12/C=C(\C)[C@H](OC(C)=O)C[C@@H](OC(C)=O)C(C)(C)/C=C/[C@H](C)[C@@H](OC(C)=O)[C@@]1(OC(C)=O)C[C@@H](C)[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H46O10/c1-20-15-16-34(8,9)30(42-24(5)37)18-29(41-23(4)36)21(2)17-28-31(44-33(40)27-13-11-10-12-14-27)22(3)19-35(28,45-26(7)39)32(20)43-25(6)38/h10-17,20,22,28-32H,18-19H2,1-9H3/b16-15+,21-17+/t20-,22+,28-,29+,30+,31-,32+,35+/m0/s1 |
| InChIKey | FZKCYZNAORCYGO-YJKPJJMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia helioscopia (ncbitaxon:154990) | whole plant (BTO:0001461) | PubMed (19099222) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| euphornin L (CHEBI:65886) has role antineoplastic agent (CHEBI:35610) |
| euphornin L (CHEBI:65886) has role metabolite (CHEBI:25212) |
| euphornin L (CHEBI:65886) is a acetate ester (CHEBI:47622) |
| euphornin L (CHEBI:65886) is a benzoate ester (CHEBI:36054) |
| euphornin L (CHEBI:65886) is a diterpenoid (CHEBI:23849) |
| euphornin L (CHEBI:65886) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (1S,2R,3aR,4R,5S,6E,9R,11R,12E,13aS)-3a,4,9,11-tetrakis(acetyloxy)-2,5,8,8,12-pentamethyl-2,3,3a,4,5,8,9,10,11,13a-decahydro-1H-cyclopenta[12]annulen-1-yl benzoate |
| Citations |
|---|