EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H44O11 |
| Net Charge | 0 |
| Average Mass | 640.726 |
| Monoisotopic Mass | 640.28836 |
| SMILES | [H][C@@]12[C@@H](OC(=O)c3ccccc3)[C@@]34CO[C@](O)([C@@](C)(O)[C@]3([H])[C@@H](C(=C)C)C=C[C@H]4OC(C)=O)[C@@]1(OC(C)=O)C[C@H](C)[C@@H]2OC(=O)CCC |
| InChI | InChI=1S/C35H44O11/c1-8-12-26(38)44-28-20(4)17-34(46-22(6)37)27(28)30(45-31(39)23-13-10-9-11-14-23)33-18-42-35(34,41)32(7,40)29(33)24(19(2)3)15-16-25(33)43-21(5)36/h9-11,13-16,20,24-25,27-30,40-41H,2,8,12,17-18H2,1,3-7H3/t20-,24+,25+,27+,28-,29-,30+,32-,33+,34+,35+/m0/s1 |
| InChIKey | PGAJUQOMDBGDPH-BYYJYFEHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia decipiens (ncbitaxon:1031519) | whole plant (BTO:0001461) | PubMed (12808253) | Air-dried ground plants |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphorbia diterpenoid 1 (CHEBI:65883) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| Euphorbia diterpenoid 1 (CHEBI:65883) has role metabolite (CHEBI:25212) |
| Euphorbia diterpenoid 1 (CHEBI:65883) is a acetate ester (CHEBI:47622) |
| Euphorbia diterpenoid 1 (CHEBI:65883) is a benzoate ester (CHEBI:36054) |
| Euphorbia diterpenoid 1 (CHEBI:65883) is a bridged compound (CHEBI:35990) |
| Euphorbia diterpenoid 1 (CHEBI:65883) is a butyrate ester (CHEBI:50477) |
| Euphorbia diterpenoid 1 (CHEBI:65883) is a cyclic ether (CHEBI:37407) |
| Euphorbia diterpenoid 1 (CHEBI:65883) is a lactol (CHEBI:38131) |
| Euphorbia diterpenoid 1 (CHEBI:65883) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (2S,3S,3aR,4R,4aR,5R,8S,8aR,9S,10R,10aR)-5,10a-bis(acetyloxy)-3-(butanoyloxy)-9,10-dihydroxy-2,9-dimethyl-8-(prop-1-en-2-yl)-2,3,3a,4,5,8,8a,9,10,10a-decahydro-1H-10,4a-(epoxymethano)benzo[f]azulen-4-yl benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9461711 | Reaxys |
| Citations |
|---|