EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O6 |
| Net Charge | 0 |
| Average Mass | 360.406 |
| Monoisotopic Mass | 360.15729 |
| SMILES | [H][C@@]12/C=C(/C)C(=O)/C=C/[C@](C)(O)C[C@@H](OC(=O)/C(C)=C/C)[C@@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C20H24O6/c1-6-11(2)18(22)26-16-10-20(5,24)8-7-14(21)12(3)9-15-17(16)13(4)19(23)25-15/h6-9,15-17,24H,4,10H2,1-3,5H3/b8-7+,11-6+,12-9-/t15-,16-,17+,20+/m1/s1 |
| InChIKey | AXSMKFJOTFGINI-AWYRNCDDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eupatorium kiirunense (IPNI:1009045-1) | - | PubMed (15921421) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eupaheliangolide A (CHEBI:65879) has functional parent tiglic acid (CHEBI:9592) |
| eupaheliangolide A (CHEBI:65879) has role antineoplastic agent (CHEBI:35610) |
| eupaheliangolide A (CHEBI:65879) has role metabolite (CHEBI:25212) |
| eupaheliangolide A (CHEBI:65879) is a enoate ester (CHEBI:51702) |
| eupaheliangolide A (CHEBI:65879) is a enone (CHEBI:51689) |
| eupaheliangolide A (CHEBI:65879) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (3aR,4R,6R,7E,10Z,11aR)-6-hydroxy-6,10-dimethyl-3-methylidene-2,9-dioxo-2,3,3a,4,5,6,9,11a-octahydrocyclodeca[b]furan-4-yl(2E)-2-methylbut-2-enoate |
| Synonym | Source |
|---|---|
| 8β-tigloyloxy-10α-hydroxy-3-oxo-6βH,7αH-helianga-1E,4Z,11(13)-trien-6,12-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11258334 | Reaxys |
| Citations |
|---|