EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | C=C1CC[C@@H](C(C)=O)[C@@H](OC(=O)/C=C/C(C)(C)O)/C=C(\C)CC[C@@H]1O |
| InChI | InChI=1S/C20H30O5/c1-13-6-9-17(22)14(2)7-8-16(15(3)21)18(12-13)25-19(23)10-11-20(4,5)24/h10-12,16-18,22,24H,2,6-9H2,1,3-5H3/b11-10+,13-12+/t16-,17-,18-/m0/s1 |
| InChIKey | OLVXTGNQLBNUDD-IHVYPXMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eunicea (ncbitaxon:86557) | - | PubMed (16180813) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eunicea sesquiterpenoid 6 (CHEBI:65876) has role metabolite (CHEBI:25212) |
| Eunicea sesquiterpenoid 6 (CHEBI:65876) is a fatty acid ester (CHEBI:35748) |
| Citations |
|---|