EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36O6 |
| Net Charge | 0 |
| Average Mass | 468.590 |
| Monoisotopic Mass | 468.25119 |
| SMILES | [H][C@@]12Oc3c(C=O)c(O)c(C=O)c(O)c3[C@@H](CC(C)C)[C@@]1(C)CC[C@@]1(O)C(=C)CCC(=C(C)C)[C@@]21[H] |
| InChI | InChI=1S/C28H36O6/c1-14(2)11-20-21-24(32)18(12-29)23(31)19(13-30)25(21)34-26-22-17(15(3)4)8-7-16(5)28(22,33)10-9-27(20,26)6/h12-14,20,22,26,31-33H,5,7-11H2,1-4,6H3/t20-,22+,26+,27-,28-/m1/s1 |
| InChIKey | LLCSUGKJCVVJBS-LQEBHLGXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eucalyptus globulus (ncbitaxon:34317) | fruit (BTO:0000486) | PubMed (18020353) | Dried fruits |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eucalyptal C (CHEBI:65871) has role antineoplastic agent (CHEBI:35610) |
| eucalyptal C (CHEBI:65871) has role metabolite (CHEBI:25212) |
| eucalyptal C (CHEBI:65871) is a benzaldehydes (CHEBI:22698) |
| eucalyptal C (CHEBI:65871) is a cyclic ether (CHEBI:37407) |
| eucalyptal C (CHEBI:65871) is a organic heterotetracyclic compound (CHEBI:38163) |
| eucalyptal C (CHEBI:65871) is a resorcinols (CHEBI:33572) |
| eucalyptal C (CHEBI:65871) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (4aS,6aR,7S,12aS,12bS)-4a,8,10-trihydroxy-6a-methyl-4-methylidene-7-(2-methylpropyl)-1-(propan-2-ylidene)-2,3,4,4a,5,6,6a,7,12a,12b-decahydro-1H-benzo[c]xanthene-9,11-dicarbaldehyde |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15778335 | Reaxys |
| Citations |
|---|