EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O7 |
| Net Charge | 0 |
| Average Mass | 486.605 |
| Monoisotopic Mass | 486.26175 |
| SMILES | [H][C@@]12Oc3c(C=O)c(O)c(C=O)c(O)c3[C@@H](CC(C)C)[C@@]1(C)CC[C@@]1(O)C(=C)CC[C@@H](C(C)(C)O)[C@@]21[H] |
| InChI | InChI=1S/C28H38O7/c1-14(2)11-19-20-23(32)16(12-29)22(31)17(13-30)24(20)35-25-21-18(26(4,5)33)8-7-15(3)28(21,34)10-9-27(19,25)6/h12-14,18-19,21,25,31-34H,3,7-11H2,1-2,4-6H3/t18-,19-,21+,25+,27-,28-/m1/s1 |
| InChIKey | VWNYEWUFLXJJJS-GDTDCKGHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eucalyptus globulus (ncbitaxon:34317) | fruit (BTO:0000486) | PubMed (18020353) | Dried fruits |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eucalyptal B (CHEBI:65870) has role antineoplastic agent (CHEBI:35610) |
| eucalyptal B (CHEBI:65870) has role metabolite (CHEBI:25212) |
| eucalyptal B (CHEBI:65870) is a benzaldehydes (CHEBI:22698) |
| eucalyptal B (CHEBI:65870) is a cyclic ether (CHEBI:37407) |
| eucalyptal B (CHEBI:65870) is a organic heterotetracyclic compound (CHEBI:38163) |
| eucalyptal B (CHEBI:65870) is a resorcinols (CHEBI:33572) |
| eucalyptal B (CHEBI:65870) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,4aS,6aR,7S,12aS,12bS)-4a,8,10-trihydroxy-1-(2-hydroxypropan-2-yl)-6a-methyl-4-methylidene-7-(2-methylpropyl)-2,3,4,4a,5,6,6a,7,12a,12b-decahydro-1H-benzo[c]xanthene-9,11-dicarbaldehyde |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15778337 | Reaxys |
| Citations |
|---|