EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H76O11 |
| Net Charge | 0 |
| Average Mass | 841.136 |
| Monoisotopic Mass | 840.53876 |
| SMILES | [H][C@@]1([C@H](C)[C@H](O)/C=C(C)/C=C/C=C/C=C/C=C/C=C/C[C@H](O)/C=C(\C)CCC(=O)O)C[C@H](O)CCC[C@H](OC)C/C=C\C=C\C[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@H](C)[C@H](O)CC(=O)O1 |
| InChI | InChI=1S/C49H76O11/c1-34(22-17-13-11-9-8-10-12-14-19-24-40(50)30-35(2)28-29-46(54)55)31-43(52)37(4)45-32-41(51)25-21-27-42(59-7)26-20-16-15-18-23-36(3)48(57)39(6)49(58)38(5)44(53)33-47(56)60-45/h8-20,22,30-31,36-45,48-53,57-58H,21,23-29,32-33H2,1-7H3,(H,54,55)/b9-8+,12-10+,13-11+,18-15+,19-14+,20-16-,22-17+,34-31+,35-30+/t36-,37+,38+,39-,40-,41+,42+,43+,44+,45-,48+,49-/m0/s1 |
| InChIKey | VHPBIOVAVQXSJO-DLGDGFEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorangium cellulosum (ncbitaxon:56) | |||
| - | PubMed (17547459) | Strain: So ce750 | |
| - | PubMed (17547459) | Strain: So ce1045 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etnangien (CHEBI:65868) has role antibacterial agent (CHEBI:33282) |
| etnangien (CHEBI:65868) has role metabolite (CHEBI:25212) |
| etnangien (CHEBI:65868) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| etnangien (CHEBI:65868) is a macrolide antibiotic (CHEBI:25105) |
| IUPAC Name |
|---|
| (4E,6S,8E,10E,12E,14E,16E,18E,20R,21R)-6,20-dihydroxy-4,18-dimethyl-21-[(2S,4R,8S,10Z,12E,15S,16R,17S,18S,19R,20R)-4,16,18,20-tetrahydroxy-8-methoxy-15,17,19-trimethyl-22-oxooxacyclodocosa-10,12-dien-2-yl]docosa-4,8,10,12,14,16,18-heptaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| DE19630980 | Patent |
| EP2014655 | Patent |
| EP2247740 | Patent |
| WO2008142046 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18923823 | Reaxys |
| Citations |
|---|