EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O6 |
| Net Charge | 0 |
| Average Mass | 378.380 |
| Monoisotopic Mass | 378.11034 |
| SMILES | CC[C@@H](C)c1cc(=O)c2c(CO)cc3c(c2o1)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C22H18O6/c1-3-10(2)16-8-15(25)17-11(9-23)7-13-19(22(17)28-16)21(27)18-12(20(13)26)5-4-6-14(18)24/h4-8,10,23-24H,3,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | HXAZTNIVBVVFJS-SNVBAGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (8931733) | Strain: cu39 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| espicufolin (CHEBI:65867) has role antimicrobial agent (CHEBI:33281) |
| espicufolin (CHEBI:65867) has role metabolite (CHEBI:25212) |
| espicufolin (CHEBI:65867) is a p-quinones (CHEBI:25830) |
| espicufolin (CHEBI:65867) is a benzyl alcohols (CHEBI:22743) |
| espicufolin (CHEBI:65867) is a naphthochromene (CHEBI:68504) |
| espicufolin (CHEBI:65867) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-[(2R)-butan-2-yl]-11-hydroxy-5-(hydroxymethyl)-4H-naphtho[2,3-h]chromene-4,7,12-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8804787 | Reaxys |
| Citations |
|---|