EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O6 |
| Net Charge | 0 |
| Average Mass | 378.380 |
| Monoisotopic Mass | 378.11034 |
| SMILES | CC[C@@H](C)c1cc(=O)c2c(CO)cc3c(c2o1)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C22H18O6/c1-3-10(2)16-8-15(25)17-11(9-23)7-13-19(22(17)28-16)21(27)18-12(20(13)26)5-4-6-14(18)24/h4-8,10,23-24H,3,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | HXAZTNIVBVVFJS-SNVBAGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (8931733) | Strain: cu39 |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| espicufolin (CHEBI:65867) has role antimicrobial agent (CHEBI:33281) |
| espicufolin (CHEBI:65867) has role metabolite (CHEBI:25212) |
| espicufolin (CHEBI:65867) is a p-quinones (CHEBI:25830) |
| espicufolin (CHEBI:65867) is a benzyl alcohols (CHEBI:22743) |
| espicufolin (CHEBI:65867) is a naphthochromene (CHEBI:68504) |
| espicufolin (CHEBI:65867) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-[(2R)-butan-2-yl]-11-hydroxy-5-(hydroxymethyl)-4H-naphtho[2,3-h]chromene-4,7,12-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8804787 | Reaxys |
| Citations |
|---|