EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | COc1c(O)cc([C@@H]2CC(=O)c3ccc(O)cc3O2)cc1CC=C(C)C |
| InChI | InChI=1S/C21H22O5/c1-12(2)4-5-13-8-14(9-18(24)21(13)25-3)19-11-17(23)16-7-6-15(22)10-20(16)26-19/h4,6-10,19,22,24H,5,11H2,1-3H3/t19-/m0/s1 |
| InChIKey | NGSGHHXJBXTNFJ-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina latissima (ncbitaxon:3844) | stem wood (BTO:0001469) | PubMed (15649516) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erylatissin C (CHEBI:65865) has functional parent (2S)-flavanone (CHEBI:15606) |
| erylatissin C (CHEBI:65865) has role antimicrobial agent (CHEBI:33281) |
| erylatissin C (CHEBI:65865) has role plant metabolite (CHEBI:76924) |
| erylatissin C (CHEBI:65865) has role radical scavenger (CHEBI:48578) |
| erylatissin C (CHEBI:65865) is a 3'-hydroxyflavanones (CHEBI:48024) |
| erylatissin C (CHEBI:65865) is a 4'-methoxyflavanones (CHEBI:140332) |
| erylatissin C (CHEBI:65865) is a dihydroxyflavanone (CHEBI:38749) |
| erylatissin C (CHEBI:65865) is a monomethoxyflavanone (CHEBI:38738) |
| IUPAC Name |
|---|
| (2S)-7-hydroxy-2-[3-hydroxy-4-methoxy-5-(3-methylbut-2-en-1-yl)phenyl]-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| (−)-7,3'-dihydroxy-4'-methoxy-5'-(γ,γ-dimethylallyl)flavanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10590939 | Reaxys |
| Citations |
|---|