EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O5 |
| Net Charge | 0 |
| Average Mass | 352.386 |
| Monoisotopic Mass | 352.13107 |
| SMILES | COc1c(O)cc(-c2coc3cc(O)ccc3c2=O)cc1CC=C(C)C |
| InChI | InChI=1S/C21H20O5/c1-12(2)4-5-13-8-14(9-18(23)21(13)25-3)17-11-26-19-10-15(22)6-7-16(19)20(17)24/h4,6-11,22-23H,5H2,1-3H3 |
| InChIKey | CEXYMYPXHMUTTJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina latissima (ncbitaxon:3844) | stem wood (BTO:0001469) | PubMed (15649516) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erylatissin A (CHEBI:65863) has role antimicrobial agent (CHEBI:33281) |
| erylatissin A (CHEBI:65863) has role metabolite (CHEBI:25212) |
| erylatissin A (CHEBI:65863) has role radical scavenger (CHEBI:48578) |
| erylatissin A (CHEBI:65863) is a 4'-methoxyisoflavones (CHEBI:133959) |
| erylatissin A (CHEBI:65863) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 7-hydroxy-3-[3-hydroxy-4-methoxy-5-(3-methylbut-2-en-1-yl)phenyl]-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 7,3'-dihydroxy-4'-methoxy-5'-(γ,γ-dimethylallyl)isoflavone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10587410 | Reaxys |
| Citations |
|---|