EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O4 |
| Net Charge | 0 |
| Average Mass | 392.495 |
| Monoisotopic Mass | 392.19876 |
| SMILES | [H][C@@]12COc3c(ccc(O)c3CC=C(C)C)[C@]1([H])Oc1c2ccc(O)c1CC=C(C)C |
| InChI | InChI=1S/C25H28O4/c1-14(2)5-7-17-21(26)12-10-19-23(17)28-13-20-16-9-11-22(27)18(8-6-15(3)4)24(16)29-25(19)20/h5-6,9-12,20,25-27H,7-8,13H2,1-4H3/t20-,25-/m0/s1 |
| InChIKey | HOGHBEDTLGAJAS-CPJSRVTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina burttii (IPNI:494372-1) | root (BTO:0001188) | DOI (10.1016/S0031-9422(01)00459-9) | Previous component: root bark; |
| Erythrina eriotricha (IPNI:494416-1) | root (BTO:0001188) | PubMed (8590641) | Previous component: root bark; |
| Erythrina mildbraedii (IPNI:494506-1) | - | DOI (10.1016/0031-9422(88)80746-5) | |
| Erythrina stricta (IPNI:494596-1) | root (BTO:0001188) | PubMed (18087807) | |
| Erythrina subumbrans (IPNI:494601-1) | |||
| bark (BTO:0001301) | PubMed (17055201) | ||
| stem (BTO:0001300) | PubMed (17055201) | ||
| Erythrina zeyheri (ncbitaxon:347911) | root (BTO:0001188) | PubMed (15597305) |
| Roles Classification |
|---|
| Biological Roles: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erybraedin A (CHEBI:65862) has functional parent (6aR,11aR)-3,9-dihydroxypterocarpan (CHEBI:15648) |
| erybraedin A (CHEBI:65862) has role antibacterial agent (CHEBI:33282) |
| erybraedin A (CHEBI:65862) has role antineoplastic agent (CHEBI:35610) |
| erybraedin A (CHEBI:65862) has role antiplasmodial drug (CHEBI:64915) |
| erybraedin A (CHEBI:65862) has role plant metabolite (CHEBI:76924) |
| erybraedin A (CHEBI:65862) is a phenols (CHEBI:33853) |
| erybraedin A (CHEBI:65862) is a pterocarpans (CHEBI:26377) |
| IUPAC Name |
|---|
| (6aR,11aR)-4,10-bis(3-methylbut-2-en-1-yl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-3,9-diol |
| Synonyms | Source |
|---|---|
| 4-prenylphaseollidin | ChEBI |
| (6aR,11aR-cis)-6a,11a-dihydro-4,10-bis(3-methyl-2-butenyl)-6H-benzofuro(3,2-c)(1)benzopyran-3,9-diol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMPK12070044 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9090260 | Reaxys |
| CAS:119269-76-0 | ChemIDplus |
| Citations |
|---|