EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H74N12O14 |
| Net Charge | 0 |
| Average Mass | 1043.190 |
| Monoisotopic Mass | 1042.54475 |
| SMILES | CCCCCCCCCCC[C@@H]1CC(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N2CCC[C@H]2C(=O)N1 |
| InChI | InChI=1S/C48H74N12O14/c1-2-3-4-5-6-7-8-9-10-12-28-22-41(67)54-32(23-38(50)64)44(70)56-31(21-27-14-16-29(62)17-15-27)43(69)57-33(24-39(51)65)45(71)55-30(18-19-37(49)63)42(68)59-35(26-61)46(72)58-34(25-40(52)66)48(74)60-20-11-13-36(60)47(73)53-28/h14-17,28,30-36,61-62H,2-13,18-26H2,1H3,(H2,49,63)(H2,50,64)(H2,51,65)(H2,52,66)(H,53,73)(H,54,67)(H,55,71)(H,56,70)(H,57,69)(H,58,72)(H,59,68)/t28-,30+,31-,32+,33+,34+,35+,36+/m1/s1 |
| InChIKey | QPLUQODTAQYAFC-FVBCJJOCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epichloe typhina (ncbitaxon:5113) | - | PubMed (17587677) | Organism is an endophytic fungus of Phleum prantense |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epichlicin (CHEBI:65849) has role antifungal agent (CHEBI:35718) |
| epichlicin (CHEBI:65849) has role fungal metabolite (CHEBI:76946) |
| epichlicin (CHEBI:65849) is a homodetic cyclic peptide (CHEBI:24613) |
| epichlicin (CHEBI:65849) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| 3-[(3R,7S,10R,13S,16S,19S,22S,27aS)-7,13,22-tris(2-amino-2-oxoethyl)-10-(4-hydroxybenzyl)-19-(hydroxymethyl)-1,5,8,11,14,17,20,23-octaoxo-3-undecylhexacosahydro-1H-pyrrolo[2,1-c][1,4,7,10,13,16,19,22]octaazacyclopentacosin-16-yl]propanamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11108273 | Reaxys |
| Citations |
|---|