EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O10 |
| Net Charge | 0 |
| Average Mass | 442.376 |
| Monoisotopic Mass | 442.09000 |
| SMILES | [H][C@]1(c2ccc(O)c(O)c2)Oc2cc(O)cc(OC(=O)c3cc(O)c(O)c(O)c3)c2C[C@H]1O |
| InChI | InChI=1S/C22H18O10/c23-11-6-18-12(8-17(28)21(31-18)9-1-2-13(24)14(25)3-9)19(7-11)32-22(30)10-4-15(26)20(29)16(27)5-10/h1-7,17,21,23-29H,8H2/t17-,21-/m1/s1 |
| InChIKey | LVJJFMLUMNSUFN-DYESRHJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Orostachys japonica (IPNI:274621-1) | whole plant (BTO:0001461) | PubMed (18977282) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.22.52 (calpain-1) inhibitor A calpain inhibitor that interferes with the action of calpain-1 (EC 3.4.22.52). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-epicatechin-5-gallate (CHEBI:65848) has functional parent (−)-epicatechin (CHEBI:90) |
| (−)-epicatechin-5-gallate (CHEBI:65848) has role EC 3.4.22.52 (calpain-1) inhibitor (CHEBI:79050) |
| (−)-epicatechin-5-gallate (CHEBI:65848) has role plant metabolite (CHEBI:76924) |
| (−)-epicatechin-5-gallate (CHEBI:65848) is a catechin (CHEBI:23053) |
| (−)-epicatechin-5-gallate (CHEBI:65848) is a gallate ester (CHEBI:37576) |
| IUPAC Name |
|---|
| (2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-5-yl 3,4,5-trihydroxybenzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18892308 | Reaxys |
| Citations |
|---|