EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | [H][C@@]12C[C@@](C)(C(=O)O)CC[C@]1(C)CC[C@]1(C)C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])CC3 |
| InChI | InChI=1S/C30H48O3/c1-25(2)21-9-8-20-19(28(21,5)12-11-23(25)31)10-13-30(7)22-18-27(4,24(32)33)15-14-26(22,3)16-17-29(20,30)6/h21-23,31H,8-18H2,1-7H3,(H,32,33)/t21-,22+,23-,26+,27-,28+,29+,30-/m0/s1 |
| InChIKey | BHVJSLPLFOAMEV-UHIFYLTQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga conifera (ncbitaxon:109817) | leaf (BTO:0000713) | DOI (10.1016/S0031-9422(02)00378-3) | |
| Coriaria intermedia (ncbitaxon:79756) | - | DOI (10.1016/0031-9422(95)00935-3) | |
| Lagenaria siceraria (ncbitaxon:3668) | stem (BTO:0001300) | PubMed (18310955) | |
| Celtis philippinensis (ncbitaxon:213552) | twig (BTO:0001411) | PubMed (12482456) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-epi-bryonolic acid (CHEBI:65846) has role antineoplastic agent (CHEBI:35610) |
| 20-epi-bryonolic acid (CHEBI:65846) has role metabolite (CHEBI:25212) |
| 20-epi-bryonolic acid (CHEBI:65846) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 20-epi-bryonolic acid (CHEBI:65846) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2S,4aS,6aS,8aR,10S,12aS,14aS,14bR)-10-hydroxy-2,4a,6a,9,9,12a,14a-heptamethyl-1,2,3,4,4a,5,6,6a,7,8,8a,9,10,11,12,12a,13,14,14a,14b-icosahydropicene-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8176385 | Reaxys |
| Citations |
|---|