EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O4 |
| Net Charge | 0 |
| Average Mass | 322.445 |
| Monoisotopic Mass | 322.21441 |
| SMILES | CCCCCCCCCCCC1=C(O)C(=O)C=C(OCC)C1=O |
| InChI | InChI=1S/C19H30O4/c1-3-5-6-7-8-9-10-11-12-13-15-18(21)16(20)14-17(19(15)22)23-4-2/h14,21H,3-13H2,1-2H3 |
| InChIKey | BKAZNQWWINLHDW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aegiceras corniculatum (ncbitaxon:59970) | |||
| stem (BTO:0001300) | PubMed (16254827) | ||
| twig (BTO:0001411) | PubMed (16254827) | ||
| Embelia ribes (ncbitaxon:459629) | |||
| leaf (BTO:0000713) | PubMed (17124632) | ||
| fruit (BTO:0000486) | PubMed (17124632) | ||
| Lysimachia punctata (ncbitaxon:213289) | root (BTO:0001188) | PubMed (15890461) | Underground part of the plant |
| Myrsine africana (ncbitaxon:59982) | fruit (BTO:0000486) | Article (ELECTRON J FOOD PLANTS CHEM, 2007, 2, 20) | |
| Oxalis erythrorhiza (IPNI:177985-2) | - | PubMed (12963150) | |
| Embelia schimperi (IPNI:588468-1) | - | PubMed (11054840) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-O-ethyl embelin (CHEBI:65843) has functional parent embelin (CHEBI:4778) |
| 5-O-ethyl embelin (CHEBI:65843) has role antineoplastic agent (CHEBI:35610) |
| 5-O-ethyl embelin (CHEBI:65843) has role metabolite (CHEBI:25212) |
| 5-O-ethyl embelin (CHEBI:65843) is a 1,4-benzoquinones (CHEBI:132124) |
| 5-O-ethyl embelin (CHEBI:65843) is a enol ether (CHEBI:47985) |
| 5-O-ethyl embelin (CHEBI:65843) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| IUPAC Name |
|---|
| 5-ethoxy-2-hydroxy-3-undecylcyclohexa-2,5-diene-1,4-dione |
| Synonym | Source |
|---|---|
| 5-ethoxy-2-hydroxy-3-undecyl-1,4-benzoquinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10027880 | Reaxys |
| Citations |
|---|