EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O3 |
| Net Charge | 0 |
| Average Mass | 252.354 |
| Monoisotopic Mass | 252.17254 |
| SMILES | [H][C@]12[C@H](C)[C@@H](O)O[C@@]1([H])CCC1=C[C@@H](O)C[C@H](C)[C@]12C |
| InChI | InChI=1S/C15H24O3/c1-8-6-11(16)7-10-4-5-12-13(15(8,10)3)9(2)14(17)18-12/h7-9,11-14,16-17H,4-6H2,1-3H3/t8-,9-,11-,12-,13-,14-,15+/m0/s1 |
| InChIKey | TTXJNGFMQRHAHH-SPYYHPLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nephthea elongata (WORMS:288668) | - | PubMed (17473464) |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elongatol A (CHEBI:65837) has role antineoplastic agent (CHEBI:35610) |
| elongatol A (CHEBI:65837) has role coral metabolite (CHEBI:76498) |
| elongatol A (CHEBI:65837) is a cyclic ether (CHEBI:37407) |
| elongatol A (CHEBI:65837) is a diol (CHEBI:23824) |
| elongatol A (CHEBI:65837) is a organic heterotricyclic compound (CHEBI:26979) |
| elongatol A (CHEBI:65837) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (1S,2S,3aS,7S,9S,9aS,9bR)-1,9,9a-trimethyl-1,2,3a,4,5,7,8,9,9a,9b-decahydronaphtho[2,1-b]furan-2,7-diol |
| Synonym | Source |
|---|---|
| lemnal-1(10)-ene-2α,12α-diol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 17626878 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11101571 | Reaxys |
| Citations |
|---|