EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O6 |
| Net Charge | 0 |
| Average Mass | 374.433 |
| Monoisotopic Mass | 374.17294 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]1([H])[C@@H](OC(=O)/C(C)=C/C)C/C(C)=C/[C@@]1(OC)C=C(C)[C@]2([H])O1 |
| InChI | InChI=1S/C21H26O6/c1-7-12(3)19(22)25-15-8-11(2)9-21(24-6)10-13(4)17(27-21)18-16(15)14(5)20(23)26-18/h7,9-10,15-18H,5,8H2,1-4,6H3/b11-9+,12-7+/t15-,16+,17-,18-,21-/m0/s1 |
| InChIKey | AFBZZDSPQOILGX-FIPHPDLKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Elephantopus mollis (ncbitaxon:318057) | |||
| stem (BTO:0001300) | PubMed (18239317) | ||
| root (BTO:0001188) | PubMed (18239317) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2β-methoxy-2-deethoxy-8-O-deacylphantomolin-8-O-tiglinate (CHEBI:65836) has functional parent tiglic acid (CHEBI:9592) |
| 2β-methoxy-2-deethoxy-8-O-deacylphantomolin-8-O-tiglinate (CHEBI:65836) has role antineoplastic agent (CHEBI:35610) |
| 2β-methoxy-2-deethoxy-8-O-deacylphantomolin-8-O-tiglinate (CHEBI:65836) has role metabolite (CHEBI:25212) |
| 2β-methoxy-2-deethoxy-8-O-deacylphantomolin-8-O-tiglinate (CHEBI:65836) is a cyclic ether (CHEBI:37407) |
| 2β-methoxy-2-deethoxy-8-O-deacylphantomolin-8-O-tiglinate (CHEBI:65836) is a enoate ester (CHEBI:51702) |
| 2β-methoxy-2-deethoxy-8-O-deacylphantomolin-8-O-tiglinate (CHEBI:65836) is a germacranolide (CHEBI:73011) |
| 2β-methoxy-2-deethoxy-8-O-deacylphantomolin-8-O-tiglinate (CHEBI:65836) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4S,6E,8S,11S,11aS)-8-methoxy-6,10-dimethyl-3-methylidene-2-oxo-2,3,3a,4,5,8,11,11a-octahydro-8,11-epoxycyclodeca[b]furan-4-yl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9875949 | Reaxys |
| Citations |
|---|