EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O6 |
| Net Charge | 0 |
| Average Mass | 360.406 |
| Monoisotopic Mass | 360.15729 |
| SMILES | [H][C@]12C(=C)C(=O)O[C@@H]1[C@]1(O)C(=C(C)C[C@@H]2OC(=O)/C(C)=C/C)C(=O)C[C@H]1C |
| InChI | InChI=1S/C20H24O6/c1-6-9(2)18(22)25-14-7-10(3)16-13(21)8-11(4)20(16,24)17-15(14)12(5)19(23)26-17/h6,11,14-15,17,24H,5,7-8H2,1-4H3/b9-6+/t11-,14+,15-,17+,20-/m1/s1 |
| InChIKey | SKWQNPANRJEPQJ-JTOVZCNQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Elephantopus mollis (ncbitaxon:318057) | |||
| root (BTO:0001188) | PubMed (18239317) | ||
| stem (BTO:0001300) | PubMed (18239317) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4βH)-5α-hydroxy-8α-(2-methylbut-2-enoyloxy)-2-oxo-1(10),11(13)-guaiadien-12,6α-olide (CHEBI:65832) has functional parent tiglic acid (CHEBI:9592) |
| (4βH)-5α-hydroxy-8α-(2-methylbut-2-enoyloxy)-2-oxo-1(10),11(13)-guaiadien-12,6α-olide (CHEBI:65832) has role antineoplastic agent (CHEBI:35610) |
| (4βH)-5α-hydroxy-8α-(2-methylbut-2-enoyloxy)-2-oxo-1(10),11(13)-guaiadien-12,6α-olide (CHEBI:65832) has role metabolite (CHEBI:25212) |
| (4βH)-5α-hydroxy-8α-(2-methylbut-2-enoyloxy)-2-oxo-1(10),11(13)-guaiadien-12,6α-olide (CHEBI:65832) is a enoate ester (CHEBI:51702) |
| (4βH)-5α-hydroxy-8α-(2-methylbut-2-enoyloxy)-2-oxo-1(10),11(13)-guaiadien-12,6α-olide (CHEBI:65832) is a guaiane sesquiterpenoid (CHEBI:36744) |
| (4βH)-5α-hydroxy-8α-(2-methylbut-2-enoyloxy)-2-oxo-1(10),11(13)-guaiadien-12,6α-olide (CHEBI:65832) is a organic heterotricyclic compound (CHEBI:26979) |
| (4βH)-5α-hydroxy-8α-(2-methylbut-2-enoyloxy)-2-oxo-1(10),11(13)-guaiadien-12,6α-olide (CHEBI:65832) is a tertiary alcohol (CHEBI:26878) |
| (4βH)-5α-hydroxy-8α-(2-methylbut-2-enoyloxy)-2-oxo-1(10),11(13)-guaiadien-12,6α-olide (CHEBI:65832) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4S,9R,9aR,9bS)-9a-hydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-2,3,3a,4,5,7,8,9,9a,9b-decahydroazuleno[4,5-b]furan-4-yl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18556305 | Reaxys |
| Citations |
|---|