EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O9 |
| Net Charge | 0 |
| Average Mass | 532.630 |
| Monoisotopic Mass | 532.26723 |
| SMILES | [H][C@@]1(O[C@@H]2C=C3CC[C@]4([H])[C@]([H])(CC(=O)[C@]5(C)[C@@H](C6=CC(=O)OC6)CC[C@]45O)[C@@]3(C)C[C@H]2O)OCC[C@H](OC)[C@@H]1O |
| InChI | InChI=1S/C29H40O9/c1-27-13-20(30)22(38-26-25(33)21(35-3)7-9-36-26)11-16(27)4-5-18-19(27)12-23(31)28(2)17(6-8-29(18,28)34)15-10-24(32)37-14-15/h10-11,17-22,25-26,30,33-34H,4-9,12-14H2,1-3H3/t17-,18-,19+,20-,21+,22-,25+,26+,27+,28+,29+/m1/s1 |
| InChIKey | PESZVAPIHIOBQI-HDOPOQRKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Elaeodendron tangenala (ncbitaxon:123414) | xylem (BTO:0001468) | PubMed (17547460) | Previous component: wood; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elaeodendroside U (CHEBI:65829) has role antineoplastic agent (CHEBI:35610) |
| elaeodendroside U (CHEBI:65829) has role metabolite (CHEBI:25212) |
| elaeodendroside U (CHEBI:65829) is a cardenolide glycoside (CHEBI:38092) |
| elaeodendroside U (CHEBI:65829) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| (2α,3β)-3-[(4-deoxy-3-O-methyl-α-L-erythro-pentopyranosyl)oxy]-2,14-dihydroxy-12-oxocarda-4,20(22)-dienolide |
| Synonym | Source |
|---|---|
| 4-[(2R,3R,8R,9S,10R,13R,14S,17R)-2,14-dihydroxy-3-{[(2S,3S,4S)-3-hydroxy-4-methoxytetrahydro-2H-pyran-2-yl]oxy}-10,13-dimethyl-12-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]furan-2(5H)-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 20567916 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11195448 | Reaxys |
| Citations |
|---|