EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44O10 |
| Net Charge | 0 |
| Average Mass | 588.694 |
| Monoisotopic Mass | 588.29345 |
| SMILES | [H][C@@]12O[C@H](C)C[C@@H](OC)[C@]1(O)O[C@]1([H])C[C@@]3(C)C(=C[C@@]1([H])O2)CC[C@]1([H])[C@]3([H])CC[C@]2(C)[C@@H](C3=CC(=O)OC3)[C@@H](OC(C)=O)C[C@]12O |
| InChI | InChI=1S/C32H44O10/c1-16-10-25(37-5)32(36)28(39-16)41-22-12-19-6-7-21-20(29(19,3)13-23(22)42-32)8-9-30(4)27(18-11-26(34)38-15-18)24(40-17(2)33)14-31(21,30)35/h11-12,16,20-25,27-28,35-36H,6-10,13-15H2,1-5H3/t16-,20+,21-,22-,23-,24+,25-,27+,28+,29+,30-,31+,32+/m1/s1 |
| InChIKey | CTLHRQFAFGUEQH-HAVIGHGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Elaeodendron tangenala (ncbitaxon:123414) | xylem (BTO:0001468) | PubMed (17547460) | Previous component: wood; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elaeodendroside T (CHEBI:65828) has role antineoplastic agent (CHEBI:35610) |
| elaeodendroside T (CHEBI:65828) has role metabolite (CHEBI:25212) |
| elaeodendroside T (CHEBI:65828) is a acetate ester (CHEBI:47622) |
| elaeodendroside T (CHEBI:65828) is a butenolide (CHEBI:50523) |
| elaeodendroside T (CHEBI:65828) is a cyclic ether (CHEBI:37407) |
| elaeodendroside T (CHEBI:65828) is a organic heterohexacyclic compound (CHEBI:51914) |
| elaeodendroside T (CHEBI:65828) is a steroid lactone (CHEBI:26766) |
| IUPAC Name |
|---|
| (1R,2S,3aS,3bR,6aR,7aS,9R,11R,11aS,12aR,13aR,13bS,15aR)-3a,11a-dihydroxy-11-methoxy-9,13a,15a-trimethyl-1-(5-oxo-2,5-dihydrofuran-3-yl)-2,3,3a,3b,4,5,6a,9,10,11,11a,12a,13,13a,13b,14,15,15a-octadecahydro-1H,7aH-cyclopenta[7,8]phenanthro[2,3-b]pyrano[3,2-e][1,4]dioxin-2-yl acetate |
| Manual Xrefs | Databases |
|---|---|
| 20567917 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11195447 | Reaxys |
| Citations |
|---|