EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42O10 |
| Net Charge | 0 |
| Average Mass | 574.667 |
| Monoisotopic Mass | 574.27780 |
| SMILES | [H][C@@]12OCC[C@@H](OC)[C@]1(O)O[C@]1([H])C[C@@]3(C)C(=C[C@@]1([H])O2)CC[C@]1([H])[C@]3([H])CC[C@]2(C)[C@@H](C3=CC(=O)OC3)[C@@H](OC(C)=O)C[C@]12O |
| InChI | InChI=1S/C31H42O10/c1-16(32)39-23-14-30(34)20-6-5-18-12-21-22(41-31(35)24(36-4)8-10-37-27(31)40-21)13-28(18,2)19(20)7-9-29(30,3)26(23)17-11-25(33)38-15-17/h11-12,19-24,26-27,34-35H,5-10,13-15H2,1-4H3/t19-,20+,21+,22+,23-,24+,26-,27-,28-,29+,30-,31-/m0/s1 |
| InChIKey | NRVDOTUZYZELQD-JJSCBUTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Elaeodendron glaucum (IPNI:160672-1) | seed (BTO:0001226) | DOI (10.1016/S0031-9422(00)81130-9) | |
| Elaeodendron tangenala (ncbitaxon:123414) | xylem (BTO:0001468) | PubMed (17547460) | Previous component: wood; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elaeodendroside G (CHEBI:65827) has role antineoplastic agent (CHEBI:35610) |
| elaeodendroside G (CHEBI:65827) has role metabolite (CHEBI:25212) |
| elaeodendroside G (CHEBI:65827) is a acetate ester (CHEBI:47622) |
| elaeodendroside G (CHEBI:65827) is a butenolide (CHEBI:50523) |
| elaeodendroside G (CHEBI:65827) is a cyclic ether (CHEBI:37407) |
| elaeodendroside G (CHEBI:65827) is a organic heterohexacyclic compound (CHEBI:51914) |
| elaeodendroside G (CHEBI:65827) is a steroid lactone (CHEBI:26766) |
| IUPAC Name |
|---|
| (1R,2S,3aS,3bR,6aR,7aS,11R,11aS,12aR,13aR,13bS,15aR)-3a,11a-dihydroxy-11-methoxy-13a,15a-dimethyl-1-(5-oxo-2,5-dihydrofuran-3-yl)-2,3,3a,3b,4,5,6a,9,10,11,11a,12a,13,13a,13b,14,15,15a-octadecahydro-1H,7aH-cyclopenta[7,8]phenanthro[2,3-b]pyrano[3,2-e][1,4]dioxin-2-yl acetate |
| Manual Xrefs | Databases |
|---|---|
| 23284661 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6580941 | Reaxys |
| Citations |
|---|