EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O8 |
| Net Charge | 0 |
| Average Mass | 516.631 |
| Monoisotopic Mass | 516.27232 |
| SMILES | [H][C@@]12OCC[C@H](OC)[C@]1(O)O[C@]1([H])C[C@@]3(C)C(=C[C@@]1([H])O2)CC[C@]1([H])[C@]3([H])CC[C@]2(C)[C@@H](C3=CC(=O)OC3)CC[C@]12O |
| InChI | InChI=1S/C29H40O8/c1-26-14-22-21(36-25-29(32,37-22)23(33-3)8-11-34-25)13-17(26)4-5-20-19(26)6-9-27(2)18(7-10-28(20,27)31)16-12-24(30)35-15-16/h12-13,18-23,25,31-32H,4-11,14-15H2,1-3H3/t18-,19+,20-,21-,22-,23+,25+,26+,27-,28+,29+/m1/s1 |
| InChIKey | GKRZHFATSIESKX-VXCHEOLLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Elaeodendron glaucum (IPNI:160672-1) | seed (BTO:0001226) | DOI (10.1016/S0031-9422(00)81130-9) | |
| Elaeodendron tangenala (ncbitaxon:123414) | xylem (BTO:0001468) | PubMed (17547460) | Previous component: wood; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elaeodendroside B (CHEBI:65825) has role antineoplastic agent (CHEBI:35610) |
| elaeodendroside B (CHEBI:65825) has role metabolite (CHEBI:25212) |
| elaeodendroside B (CHEBI:65825) is a butenolide (CHEBI:50523) |
| elaeodendroside B (CHEBI:65825) is a cyclic ether (CHEBI:37407) |
| elaeodendroside B (CHEBI:65825) is a lactol (CHEBI:38131) |
| elaeodendroside B (CHEBI:65825) is a organic heterohexacyclic compound (CHEBI:51914) |
| elaeodendroside B (CHEBI:65825) is a steroid lactone (CHEBI:26766) |
| elaeodendroside B (CHEBI:65825) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 4-[(1R,3aS,3bR,6aR,7aS,11S,11aS,12aR,13aR,13bS,15aR)-3a,11a-dihydroxy-11-methoxy-13a,15a-dimethyl-2,3,3a,3b,4,5,6a,9,10,11,11a,12a,13,13a,13b,14,15,15a-octadecahydro-1H,7aH-cyclopenta[7,8]phenanthro[2,3-b]pyrano[3,2-e][1,4]dioxin-1-yl]furan-2(5H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3599480 | Reaxys |
| Citations |
|---|