EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32N2O7 |
| Net Charge | 0 |
| Average Mass | 520.582 |
| Monoisotopic Mass | 520.22095 |
| SMILES | [H][C@@]12O[C@]1([H])C(=O)C(NC(=O)/C=C/C=C/C=C/C(C)CC)=C[C@@]2(O)/C=C/C=C/C=C/C(=O)NC1=C(O)CCC1=O |
| InChI | InChI=1S/C29H32N2O7/c1-3-19(2)12-8-4-5-9-13-23(34)30-20-18-29(37,28-27(38-28)26(20)36)17-11-7-6-10-14-24(35)31-25-21(32)15-16-22(25)33/h4-14,17-19,27-28,32,37H,3,15-16H2,1-2H3,(H,30,34)(H,31,35)/b5-4+,7-6+,12-8+,13-9+,14-10+,17-11+/t19?,27-,28-,29+/m1/s1 |
| InChIKey | OTILGUINRVYYKM-BSZZVILASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (8982334) | Strain: E 1511 |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 3.4.22.36 (caspase-1) inhibitor Any EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the activity of caspase-1 (EC 3.4.22.36). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EI-1511-5 (CHEBI:65823) has role anti-inflammatory agent (CHEBI:67079) |
| EI-1511-5 (CHEBI:65823) has role antimicrobial agent (CHEBI:33281) |
| EI-1511-5 (CHEBI:65823) has role bacterial metabolite (CHEBI:76969) |
| EI-1511-5 (CHEBI:65823) has role EC 3.4.22.36 (caspase-1) inhibitor (CHEBI:76795) |
| EI-1511-5 (CHEBI:65823) is a cyclic ketone (CHEBI:3992) |
| EI-1511-5 (CHEBI:65823) is a enol (CHEBI:33823) |
| EI-1511-5 (CHEBI:65823) is a epoxide (CHEBI:32955) |
| EI-1511-5 (CHEBI:65823) is a monocarboxylic acid amide (CHEBI:29347) |
| EI-1511-5 (CHEBI:65823) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2E,4E,6E)-N-[(1S,5S,6R)-5-hydroxy-5-{(1E,3E,5E)-7-[(2-hydroxy-5-oxocyclopent-1-en-1-yl)amino]-7-oxohepta-1,3,5-trien-1-yl}-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-8-methyldeca-2,4,6-trienamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7630198 | Reaxys |
| Citations |
|---|