EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N2O7 |
| Net Charge | 0 |
| Average Mass | 494.544 |
| Monoisotopic Mass | 494.20530 |
| SMILES | [H][C@@]12O[C@]1([H])C(=O)C(NC(=O)/C=C/C=C/CC(C)C)=C[C@@]2(O)/C=C/C=C/C=C/C(=O)NC1=C(O)CCC1=O |
| InChI | InChI=1S/C27H30N2O7/c1-17(2)10-6-5-8-11-21(32)28-18-16-27(35,26-25(36-26)24(18)34)15-9-4-3-7-12-22(33)29-23-19(30)13-14-20(23)31/h3-9,11-12,15-17,25-26,30,35H,10,13-14H2,1-2H3,(H,28,32)(H,29,33)/b4-3+,6-5+,11-8+,12-7+,15-9+/t25-,26-,27+/m1/s1 |
| InChIKey | NUTSBYCZDOSSIV-FFXBEMEVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (8982334) | Strain: E 1511 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EI-1511-3 (CHEBI:65822) has role anti-inflammatory agent (CHEBI:67079) |
| EI-1511-3 (CHEBI:65822) has role antibacterial agent (CHEBI:33282) |
| EI-1511-3 (CHEBI:65822) has role metabolite (CHEBI:25212) |
| EI-1511-3 (CHEBI:65822) is a cyclic ketone (CHEBI:3992) |
| EI-1511-3 (CHEBI:65822) is a enamide (CHEBI:51751) |
| EI-1511-3 (CHEBI:65822) is a enol (CHEBI:33823) |
| EI-1511-3 (CHEBI:65822) is a epoxide (CHEBI:32955) |
| EI-1511-3 (CHEBI:65822) is a polyene antibiotic (CHEBI:26177) |
| EI-1511-3 (CHEBI:65822) is a secondary carboxamide (CHEBI:140325) |
| EI-1511-3 (CHEBI:65822) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2E,4E)-N-[(1S,5S,6R)-5-hydroxy-5-{(1E,3E,5E)-7-[(2-hydroxy-5-oxocyclopent-1-en-1-yl)amino]-7-oxohepta-1,3,5-trien-1-yl}-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-7-methylocta-2,4-dienamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7630280 | Reaxys |
| Citations |
|---|