EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N2O7 |
| Net Charge | 0 |
| Average Mass | 494.544 |
| Monoisotopic Mass | 494.20530 |
| SMILES | [H][C@@]12O[C@]1([H])C(=O)C(NC(=O)/C=C/C=C/CC(C)C)=C[C@@]2(O)/C=C/C=C/C=C/C(=O)NC1=C(O)CCC1=O |
| InChI | InChI=1S/C27H30N2O7/c1-17(2)10-6-5-8-11-21(32)28-18-16-27(35,26-25(36-26)24(18)34)15-9-4-3-7-12-22(33)29-23-19(30)13-14-20(23)31/h3-9,11-12,15-17,25-26,30,35H,10,13-14H2,1-2H3,(H,28,32)(H,29,33)/b4-3+,6-5+,11-8+,12-7+,15-9+/t25-,26-,27+/m1/s1 |
| InChIKey | NUTSBYCZDOSSIV-FFXBEMEVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (8982334) | Strain: E 1511 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EI-1511-3 (CHEBI:65822) has role anti-inflammatory agent (CHEBI:67079) |
| EI-1511-3 (CHEBI:65822) has role antibacterial agent (CHEBI:33282) |
| EI-1511-3 (CHEBI:65822) has role metabolite (CHEBI:25212) |
| EI-1511-3 (CHEBI:65822) is a cyclic ketone (CHEBI:3992) |
| EI-1511-3 (CHEBI:65822) is a enamide (CHEBI:51751) |
| EI-1511-3 (CHEBI:65822) is a enol (CHEBI:33823) |
| EI-1511-3 (CHEBI:65822) is a epoxide (CHEBI:32955) |
| EI-1511-3 (CHEBI:65822) is a polyene antibiotic (CHEBI:26177) |
| EI-1511-3 (CHEBI:65822) is a secondary carboxamide (CHEBI:140325) |
| EI-1511-3 (CHEBI:65822) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2E,4E)-N-[(1S,5S,6R)-5-hydroxy-5-{(1E,3E,5E)-7-[(2-hydroxy-5-oxocyclopent-1-en-1-yl)amino]-7-oxohepta-1,3,5-trien-1-yl}-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-7-methylocta-2,4-dienamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7630280 | Reaxys |
| Citations |
|---|