EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O4 |
| Net Charge | 0 |
| Average Mass | 350.414 |
| Monoisotopic Mass | 350.15181 |
| SMILES | [H][C@]12C=C(C)C[C@@]3(Oc4ccc(O)cc41)C(=O)C=CC(=O)[C@]23CC=C(C)C |
| InChI | InChI=1S/C22H22O4/c1-13(2)8-9-21-17-10-14(3)12-22(21,20(25)7-6-19(21)24)26-18-5-4-15(23)11-16(17)18/h4-8,10-11,17,23H,9,12H2,1-3H3/t17-,21-,22+/m0/s1 |
| InChIKey | HBDVLYQTRSOPRO-BULFRSBZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ehretia buxifolia (IPNI:115986-1) | root (BTO:0001188) | PubMed (8759162) | Previous component: root bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antidote Any protective agent counteracting or neutralizing the action of poisons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ehretianone (CHEBI:65821) has role antidote (CHEBI:50247) |
| ehretianone (CHEBI:65821) has role metabolite (CHEBI:25212) |
| ehretianone (CHEBI:65821) is a cyclic ether (CHEBI:37407) |
| ehretianone (CHEBI:65821) is a cyclic ketone (CHEBI:3992) |
| ehretianone (CHEBI:65821) is a organic heterotetracyclic compound (CHEBI:38163) |
| ehretianone (CHEBI:65821) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (4aS,9S,9aR)-7-hydroxy-12-methyl-9a-(3-methylbut-2-en-1-yl)-9,9a-dihydro-9,4a-prop[1]enoxanthene-1,4-dione |
| Synonym | Source |
|---|---|
| 7-hydroxy-9aα-(3-methylbut-2-enyl)-4aα,9α-(2-methylprop-2-enyl)-4a,9a-dihydro-1,4-dioxoxanthene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:176050-43-4 | ChemIDplus |
| Citations |
|---|