EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H10O9 |
| Net Charge | 0 |
| Average Mass | 370.269 |
| Monoisotopic Mass | 370.03248 |
| SMILES | Oc1cc(O)c2oc3cc(O)c4oc5cc(O)cc(O)c5oc4c3oc2c1 |
| InChI | InChI=1S/C18H10O9/c19-6-1-8(21)14-11(3-6)26-17-13(24-14)5-10(23)16-18(17)27-15-9(22)2-7(20)4-12(15)25-16/h1-5,19-23H |
| InChIKey | LBHQACSAGWCMAB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ecklonia stolonifera (ncbitaxon:169768) | - | PubMed (12913249) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Applications: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eckstolonol (CHEBI:65820) has functional parent phloroglucinol (CHEBI:16204) |
| eckstolonol (CHEBI:65820) has role metabolite (CHEBI:25212) |
| eckstolonol (CHEBI:65820) has role radical scavenger (CHEBI:48578) |
| eckstolonol (CHEBI:65820) is a organic heteropentacyclic compound (CHEBI:38164) |
| eckstolonol (CHEBI:65820) is a oxacycle (CHEBI:38104) |
| eckstolonol (CHEBI:65820) is a phlorotannin (CHEBI:71222) |
| IUPAC Name |
|---|
| [1,4]benzodioxino[2,3-a]oxanthrene-1,3,6,9,11-pentol |
| Synonyms | Source |
|---|---|
| 5,8,13,14-tetraoxa-pentaphene-1,3,6,9,11-pentol | ChEBI |
| dioxinodehydroeckol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8604642 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6544127 | Reaxys |
| Citations |
|---|