EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O5 |
| Net Charge | 0 |
| Average Mass | 482.661 |
| Monoisotopic Mass | 482.30322 |
| SMILES | [H][C@@]12C[C@](C)(C(=O)OC)CC[C@]1(C)CC[C@]1(C)C3=CC=C(C(C)=O)/C(=C\C(=O)OC)[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C30H42O5/c1-19(31)20-9-10-22-28(4,21(20)17-24(32)34-7)14-16-30(6)23-18-27(3,25(33)35-8)12-11-26(23,2)13-15-29(22,30)5/h9-10,17,23H,11-16,18H2,1-8H3/b21-17+/t23-,26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | RJLTUQKBCWHJFJ-ACCWSZCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hippocratea excelsa (IPNI:161537-1) | root (BTO:0001188) | PubMed (17385912) | Previous component: root bark; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dzununcanone (CHEBI:65818) has role antiprotozoal drug (CHEBI:35820) |
| dzununcanone (CHEBI:65818) has role metabolite (CHEBI:25212) |
| dzununcanone (CHEBI:65818) is a enoate ester (CHEBI:51702) |
| dzununcanone (CHEBI:65818) is a methyl ester (CHEBI:25248) |
| dzununcanone (CHEBI:65818) is a methyl ketone (CHEBI:51867) |
| dzununcanone (CHEBI:65818) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| methyl (3R,4aR,4bS,6aR,7Z,10bS,12aS)-8-acetyl-7-(2-methoxy-2-oxoethylidene)-3,4b,6a,10b,12a-pentamethyl-1,2,3,4,4a,4b,5,6,6a,7,10b,11,12,12a-tetradecahydrochrysene-3-carboxylate |
| Synonym | Source |
|---|---|
| 3,24-dinor-2,4-seco-4-oxo-friedelan-1(10),5,7-triene-2,29-dioic acid dimethylester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11223004 | Reaxys |
| Citations |
|---|