EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H45NO4 |
| Net Charge | 0 |
| Average Mass | 495.704 |
| Monoisotopic Mass | 495.33486 |
| SMILES | [H][C@]12CC=C3[C@]4([H])C[C@](C)(C(=O)O)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)/C(=C\NC=O)[C@]21C |
| InChI | InChI=1S/C31H45NO4/c1-26(2)22-10-11-30(6)23(31(22,7)21(24(26)34)17-32-18-33)9-8-19-20-16-28(4,25(35)36)13-12-27(20,3)14-15-29(19,30)5/h8,17-18,20,22-23H,9-16H2,1-7H3,(H,32,33)(H,35,36)/b21-17+/t20-,22-,23-,27+,28+,29+,30+,31-/m0/s1 |
| InChIKey | ZZTXYUVDEDOUDW-XYNNUCQCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum hainanense (IPNI:578154-1) | whole plant (BTO:0001461) | PubMed (18771268) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysoxyhainanin A (CHEBI:65817) has role antibacterial agent (CHEBI:33282) |
| dysoxyhainanin A (CHEBI:65817) has role metabolite (CHEBI:25212) |
| dysoxyhainanin A (CHEBI:65817) is a formamides (CHEBI:24079) |
| dysoxyhainanin A (CHEBI:65817) is a oxo monocarboxylic acid (CHEBI:35871) |
| dysoxyhainanin A (CHEBI:65817) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (1Z,3aR,5aR,5bS,7aS,10R,11aR,13aS,13bR)-1-[(formylamino)methylidene]-3,3,5a,5b,7a,10,13b-heptamethyl-2-oxo-2,3,3a,4,5,5a,5b,6,7,7a,8,9,10,11,11a,13,13a,13b-octadecahydro-1H-cyclopenta[a]chrysene-10-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19175393 | Reaxys |
| Citations |
|---|