EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33NO6S |
| Net Charge | 0 |
| Average Mass | 451.585 |
| Monoisotopic Mass | 451.20286 |
| SMILES | [H][C@@]12CCC=C(C)[C@@]1(C)CC[C@](C)(CC1=C(O)C(=O)C=C(NCCS(=O)(=O)O)C1=O)[C@@H]2C |
| InChI | InChI=1S/C23H33NO6S/c1-14-6-5-7-17-15(2)22(3,8-9-23(14,17)4)13-16-20(26)18(12-19(25)21(16)27)24-10-11-31(28,29)30/h6,12,15,17,24,27H,5,7-11,13H2,1-4H3,(H,28,29,30)/t15-,17+,22-,23-/m1/s1 |
| InChIKey | HHKUTKBQEPDLMV-CIVZFWGOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysidea (ncbitaxon:190526) | - | PubMed (11374954) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysidine (CHEBI:65816) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| dysidine (CHEBI:65816) has role metabolite (CHEBI:25212) |
| dysidine (CHEBI:65816) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| dysidine (CHEBI:65816) is a octahydronaphthalenes (CHEBI:138397) |
| dysidine (CHEBI:65816) is a organosulfonic acid (CHEBI:33551) |
| dysidine (CHEBI:65816) is a secondary amino compound (CHEBI:50995) |
| dysidine (CHEBI:65816) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 2-[(4-hydroxy-3,6-dioxo-5-{[(1R,2R,4aS,8aS)-1,2,4a,5-tetramethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-2-yl]methyl}cyclohexa-1,4-dien-1-yl)amino]ethanesulfonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8810146 | Reaxys |
| Citations |
|---|