EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33NO6S |
| Net Charge | 0 |
| Average Mass | 451.585 |
| Monoisotopic Mass | 451.20286 |
| SMILES | [H][C@@]12CCC=C(C)[C@@]1(C)CC[C@](C)(CC1=C(O)C(=O)C=C(NCCS(=O)(=O)O)C1=O)[C@@H]2C |
| InChI | InChI=1S/C23H33NO6S/c1-14-6-5-7-17-15(2)22(3,8-9-23(14,17)4)13-16-20(26)18(12-19(25)21(16)27)24-10-11-31(28,29)30/h6,12,15,17,24,27H,5,7-11,13H2,1-4H3,(H,28,29,30)/t15-,17+,22-,23-/m1/s1 |
| InChIKey | HHKUTKBQEPDLMV-CIVZFWGOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysidea (ncbitaxon:190526) | - | PubMed (11374954) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dysidine (CHEBI:65816) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| dysidine (CHEBI:65816) has role metabolite (CHEBI:25212) |
| dysidine (CHEBI:65816) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| dysidine (CHEBI:65816) is a octahydronaphthalenes (CHEBI:138397) |
| dysidine (CHEBI:65816) is a organosulfonic acid (CHEBI:33551) |
| dysidine (CHEBI:65816) is a secondary amino compound (CHEBI:50995) |
| dysidine (CHEBI:65816) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 2-[(4-hydroxy-3,6-dioxo-5-{[(1R,2R,4aS,8aS)-1,2,4a,5-tetramethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-2-yl]methyl}cyclohexa-1,4-dien-1-yl)amino]ethanesulfonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8810146 | Reaxys |
| Citations |
|---|