EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H82O25 |
| Net Charge | 0 |
| Average Mass | 1155.247 |
| Monoisotopic Mass | 1154.51452 |
| SMILES | [H][C@]1(O[C@H]2C[C@@H](O[C@H]3C[C@@H](O[C@H]4C[C@@H](O)[C@H](O)[C@@H](C)O4)[C@@H](OC(C)=O)[C@@H](C)O3)[C@H](O)[C@@H](C)O2)C(=O)c2c(cc3cc(O[C@H]4C[C@@H](O[C@H]5C[C@@H](O)[C@H](O)[C@@H](C)O5)[C@H](O)[C@@H](C)O4)c(C(C)CC)c(O)c3c2O)C[C@]1([H])C(OC)C(=O)C(O)C(C)O |
| InChI | InChI=1S/C56H82O25/c1-11-20(2)42-33(77-39-17-34(48(64)24(6)73-39)78-37-15-31(59)46(62)22(4)71-37)14-29-12-28-13-30(55(70-10)53(69)45(61)21(3)57)56(52(68)44(28)51(67)43(29)50(42)66)81-41-18-35(49(65)25(7)74-41)79-40-19-36(54(26(8)75-40)76-27(9)58)80-38-16-32(60)47(63)23(5)72-38/h12,14,20-26,30-32,34-41,45-49,54-57,59-67H,11,13,15-19H2,1-10H3/t20?,21?,22-,23-,24-,25-,26-,30-,31-,32-,34-,35-,36-,37+,38+,39+,40+,41+,45?,46-,47-,48-,49-,54+,55?,56-/m1/s1 |
| InChIKey | ICFBIVXFINBMRC-SRFJPACDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinoplanes durhamensis (ncbitaxon:113563) | - | PubMed (12193009) | Methylethylketone extract of fermentation broth of Actinoplanes durhamensis |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| durhamycin B (CHEBI:65815) has role anti-HIV agent (CHEBI:64946) |
| durhamycin B (CHEBI:65815) has role metabolite (CHEBI:25212) |
| durhamycin B (CHEBI:65815) is a acetate ester (CHEBI:47622) |
| durhamycin B (CHEBI:65815) is a aureolic acid (CHEBI:52513) |
| durhamycin B (CHEBI:65815) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| durhamycin B (CHEBI:65815) is a carbotricyclic compound (CHEBI:38032) |
| durhamycin B (CHEBI:65815) is a dideoxyhexose derivative (CHEBI:63347) |
| IUPAC Name |
|---|
| 1-C-[(2R*,3R*)-6-(butan-2-yl)-7-{[2,6-dideoxy-3-O-(2,6-dideoxy-β-D-arabino-hexopyranosyl)-β-D-arabino-hexopyranosyl]oxy}-3-{[2,6-dideoxy-β-D-arabino-hexopyranosyl-(1→3)-4-O-acetyl-2,6-dideoxy-β-D-lyxo-hexopyranosyl-(1→3)-2,6-dideoxy-β-D-arabino-hexopyranosyl]oxy}-5,10-dihydroxy-4-oxo-1,2,3,4-tetrahydroanthracen-2-yl]-5-deoxy-1-O-methylpent-2-ulose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9250229 | Reaxys |
| Citations |
|---|