EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H82O25 |
| Net Charge | 0 |
| Average Mass | 1155.247 |
| Monoisotopic Mass | 1154.51452 |
| SMILES | [H][C@]1(O[C@H]2C[C@@H](O[C@H]3C[C@@H](O[C@H]4C[C@@H](O)[C@H](O)[C@@H](C)O4)[C@@H](OC(C)=O)[C@@H](C)O3)[C@H](O)[C@@H](C)O2)C(=O)c2c(cc3cc(O[C@H]4C[C@@H](O[C@H]5C[C@@H](O)[C@H](O)[C@@H](C)O5)[C@H](O)[C@@H](C)O4)c(C(C)CC)c(O)c3c2O)C[C@]1([H])C(OC)C(=O)C(O)C(C)O |
| InChI | InChI=1S/C56H82O25/c1-11-20(2)42-33(77-39-17-34(48(64)24(6)73-39)78-37-15-31(59)46(62)22(4)71-37)14-29-12-28-13-30(55(70-10)53(69)45(61)21(3)57)56(52(68)44(28)51(67)43(29)50(42)66)81-41-18-35(49(65)25(7)74-41)79-40-19-36(54(26(8)75-40)76-27(9)58)80-38-16-32(60)47(63)23(5)72-38/h12,14,20-26,30-32,34-41,45-49,54-57,59-67H,11,13,15-19H2,1-10H3/t20?,21?,22-,23-,24-,25-,26-,30-,31-,32-,34-,35-,36-,37+,38+,39+,40+,41+,45?,46-,47-,48-,49-,54+,55?,56-/m1/s1 |
| InChIKey | ICFBIVXFINBMRC-SRFJPACDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinoplanes durhamensis (ncbitaxon:113563) | - | PubMed (12193009) | Methylethylketone extract of fermentation broth of Actinoplanes durhamensis |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| durhamycin B (CHEBI:65815) has role anti-HIV agent (CHEBI:64946) |
| durhamycin B (CHEBI:65815) has role metabolite (CHEBI:25212) |
| durhamycin B (CHEBI:65815) is a acetate ester (CHEBI:47622) |
| durhamycin B (CHEBI:65815) is a aureolic acid (CHEBI:52513) |
| durhamycin B (CHEBI:65815) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| durhamycin B (CHEBI:65815) is a carbotricyclic compound (CHEBI:38032) |
| durhamycin B (CHEBI:65815) is a dideoxyhexose derivative (CHEBI:63347) |
| IUPAC Name |
|---|
| 1-C-[(2R*,3R*)-6-(butan-2-yl)-7-{[2,6-dideoxy-3-O-(2,6-dideoxy-β-D-arabino-hexopyranosyl)-β-D-arabino-hexopyranosyl]oxy}-3-{[2,6-dideoxy-β-D-arabino-hexopyranosyl-(1→3)-4-O-acetyl-2,6-dideoxy-β-D-lyxo-hexopyranosyl-(1→3)-2,6-dideoxy-β-D-arabino-hexopyranosyl]oxy}-5,10-dihydroxy-4-oxo-1,2,3,4-tetrahydroanthracen-2-yl]-5-deoxy-1-O-methylpent-2-ulose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9250229 | Reaxys |
| Citations |
|---|