EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34O6 |
| Net Charge | 0 |
| Average Mass | 490.596 |
| Monoisotopic Mass | 490.23554 |
| SMILES | CC(C)=CCc1ccc(-c2oc3c4c(c5c(c3c(=O)c2O)OC(C)(C)CC5)OC(C)(C)CC4)cc1O |
| InChI | InChI=1S/C30H34O6/c1-16(2)7-8-17-9-10-18(15-21(17)31)25-24(33)23(32)22-27(34-25)19-11-13-29(3,4)35-26(19)20-12-14-30(5,6)36-28(20)22/h7,9-10,15,31,33H,8,11-14H2,1-6H3 |
| InChIKey | JHDGWJWVSUFMAQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dorstenia psilurus (ncbitaxon:106723) | root (BTO:0001188) | PubMed (19061390) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dorsilurin K (CHEBI:65808) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| dorsilurin K (CHEBI:65808) has role metabolite (CHEBI:25212) |
| dorsilurin K (CHEBI:65808) is a extended flavonoid (CHEBI:71037) |
| dorsilurin K (CHEBI:65808) is a flavonols (CHEBI:28802) |
| dorsilurin K (CHEBI:65808) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 11-hydroxy-10-[3-hydroxy-4-(3-methylbut-2-en-1-yl)phenyl]-2,2,6,6-tetramethyl-3,4,7,8-tetrahydro-2H,6H,12H-dipyrano[2,3-f:2',3'-h]chromen-12-one |
| Synonym | Source |
|---|---|
| 5,6-7,8-bis(2,2-dimethyldihydropyrano)-3'-hydroxy-4'-prenyl-flavonol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19384762 | Reaxys |
| Citations |
|---|