EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34O7 |
| Net Charge | 0 |
| Average Mass | 506.595 |
| Monoisotopic Mass | 506.23045 |
| SMILES | C=C(C)[C@@H](O)Cc1ccc(-c2oc3c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c3c(=O)c2O)cc1O |
| InChI | InChI=1S/C30H34O7/c1-15(2)7-11-20-25(33)21(12-8-16(3)4)30-24(26(20)34)27(35)28(36)29(37-30)19-10-9-18(23(32)14-19)13-22(31)17(5)6/h7-10,14,22,31-34,36H,5,11-13H2,1-4,6H3/t22-/m0/s1 |
| InChIKey | YIQFHSHQZCNILL-QFIPXVFZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dorstenia psilurus (ncbitaxon:106723) | root (BTO:0001188) | PubMed (19061390) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dorsilurin G (CHEBI:65804) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| dorsilurin G (CHEBI:65804) has role metabolite (CHEBI:25212) |
| dorsilurin G (CHEBI:65804) is a 7-hydroxyflavonol (CHEBI:52267) |
| dorsilurin G (CHEBI:65804) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-{3-hydroxy-4-[(2S)-2-hydroxy-3-methylbut-3-en-1-yl]phenyl}-6,8-bis(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 6,8-diprenyl-4'-(2S-hydroxy-3-methylbut-3-enyl)-5,7,3'-trihydroxyflavonol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19384768 | Reaxys |
| Citations |
|---|