EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O3 |
| Net Charge | 0 |
| Average Mass | 190.198 |
| Monoisotopic Mass | 190.06299 |
| SMILES | C=C/C=C1/C(=O)C(O)=C2C=CCOC21 |
| InChI | InChI=1S/C11H10O3/c1-2-4-7-9(12)10(13)8-5-3-6-14-11(7)8/h2-5,11,13H,1,6H2/b7-4- |
| InChIKey | CCVQPAZRNPBPPA-DAXSKMNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diplosoma virens (ncbitaxon:322858) | - | PubMed (18463568) | |
| Ulosa (ncbitaxon:85796) | - | DOI (10.1016/S0040-4039(01)85425-3) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-7-prop-2-en-(E)-ylidene-7,7a-dihydro- 2H-cyclopenta[b]pyran-6-one (CHEBI:65800) has role antimicrobial agent (CHEBI:33281) |
| 5-hydroxy-7-prop-2-en-(E)-ylidene-7,7a-dihydro- 2H-cyclopenta[b]pyran-6-one (CHEBI:65800) has role antineoplastic agent (CHEBI:35610) |
| 5-hydroxy-7-prop-2-en-(E)-ylidene-7,7a-dihydro- 2H-cyclopenta[b]pyran-6-one (CHEBI:65800) has role metabolite (CHEBI:25212) |
| 5-hydroxy-7-prop-2-en-(E)-ylidene-7,7a-dihydro- 2H-cyclopenta[b]pyran-6-one (CHEBI:65800) is a cyclic ether (CHEBI:37407) |
| 5-hydroxy-7-prop-2-en-(E)-ylidene-7,7a-dihydro- 2H-cyclopenta[b]pyran-6-one (CHEBI:65800) is a enol (CHEBI:33823) |
| 5-hydroxy-7-prop-2-en-(E)-ylidene-7,7a-dihydro- 2H-cyclopenta[b]pyran-6-one (CHEBI:65800) is a enone (CHEBI:51689) |
| 5-hydroxy-7-prop-2-en-(E)-ylidene-7,7a-dihydro- 2H-cyclopenta[b]pyran-6-one (CHEBI:65800) is a organic heterobicyclic compound (CHEBI:27171) |
| IUPAC Name |
|---|
| (7E)-5-hydroxy-7-(prop-2-en-1-ylidene)-7,7a-dihydrocyclopenta[b]pyran-6(2H)-one |
| Synonym | Source |
|---|---|
| Diplosoma ylidene 1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15800346 | Reaxys |
| Citations |
|---|