EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H64N8O14 |
| Net Charge | 0 |
| Average Mass | 856.972 |
| Monoisotopic Mass | 856.45420 |
| SMILES | CCCCCCC1CCC(O)(C(C)(O)C(=O)NC2C(=O)N3NCCCC3C(=O)N(O)C(COC)C(=O)NCC(=O)N3NCCCC3C(=O)N(O)C(C)C(=O)OC2C)OC1C |
| InChI | InChI=1S/C38H64N8O14/c1-7-8-9-10-13-25-16-17-38(55,60-23(25)3)37(5,54)36(53)42-30-24(4)59-35(52)22(2)45(56)32(49)26-14-11-18-40-43(26)29(47)20-39-31(48)28(21-58-6)46(57)33(50)27-15-12-19-41-44(27)34(30)51/h22-28,30,40-41,54-57H,7-21H2,1-6H3,(H,39,48)(H,42,53) |
| InChIKey | IHQIMVZJVJTKSV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseoaurantiacus (ncbitaxon:68213) | - | PubMed (10048567) | Strain: MK393 AF2 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diperamycin (CHEBI:65799) has role antibacterial agent (CHEBI:33282) |
| diperamycin (CHEBI:65799) has role antimicrobial agent (CHEBI:33281) |
| diperamycin (CHEBI:65799) has role metabolite (CHEBI:25212) |
| diperamycin (CHEBI:65799) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| N-[6,18-dihydroxy-7-(methoxymethyl)-19,22-dimethyl-5,8,11,17,20,24-hexaoxodocosahydro-13H,22H-dipyridazino[6,1-f:6',1'-o][1,4,7,10,13,16]oxapentaazacyclononadecin-23-yl]-2-(5-hexyl-2-hydroxy-6-methyltetrahydro-2H-pyran-2-yl)-2-hydroxypropanamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8468749 | Reaxys |
| Citations |
|---|