EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H64N8O14 |
| Net Charge | 0 |
| Average Mass | 856.972 |
| Monoisotopic Mass | 856.45420 |
| SMILES | CCCCCCC1CCC(O)(C(C)(O)C(=O)NC2C(=O)N3NCCCC3C(=O)N(O)C(COC)C(=O)NCC(=O)N3NCCCC3C(=O)N(O)C(C)C(=O)OC2C)OC1C |
| InChI | InChI=1S/C38H64N8O14/c1-7-8-9-10-13-25-16-17-38(55,60-23(25)3)37(5,54)36(53)42-30-24(4)59-35(52)22(2)45(56)32(49)26-14-11-18-40-43(26)29(47)20-39-31(48)28(21-58-6)46(57)33(50)27-15-12-19-41-44(27)34(30)51/h22-28,30,40-41,54-57H,7-21H2,1-6H3,(H,39,48)(H,42,53) |
| InChIKey | IHQIMVZJVJTKSV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseoaurantiacus (ncbitaxon:68213) | - | PubMed (10048567) | Strain: MK393 AF2 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diperamycin (CHEBI:65799) has role antibacterial agent (CHEBI:33282) |
| diperamycin (CHEBI:65799) has role antimicrobial agent (CHEBI:33281) |
| diperamycin (CHEBI:65799) has role metabolite (CHEBI:25212) |
| diperamycin (CHEBI:65799) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| N-[6,18-dihydroxy-7-(methoxymethyl)-19,22-dimethyl-5,8,11,17,20,24-hexaoxodocosahydro-13H,22H-dipyridazino[6,1-f:6',1'-o][1,4,7,10,13,16]oxapentaazacyclononadecin-23-yl]-2-(5-hexyl-2-hydroxy-6-methyltetrahydro-2H-pyran-2-yl)-2-hydroxypropanamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8468749 | Reaxys |
| Citations |
|---|