EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O4 |
| Net Charge | 0 |
| Average Mass | 468.678 |
| Monoisotopic Mass | 468.32396 |
| SMILES | [H][C@]12CC[C@]3([H])C4=CC(C)(C)C(=O)C[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H44O4/c1-25(2)16-19-18-8-9-21-27(5)12-11-22(31)26(3,4)20(27)10-13-29(21,7)28(18,6)14-15-30(19,24(33)34)17-23(25)32/h16,18,20-21H,8-15,17H2,1-7H3,(H,33,34)/t18-,20+,21-,27+,28-,29-,30-/m1/s1 |
| InChIKey | RKRGWMZAXCZBPG-AECKPYPVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia aulacocarpa (ncbitaxon:138511) | leaf (BTO:0000713) | PubMed (11735581) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,21-dioxoolean-18-en-28-oic acid (CHEBI:65798) has parent hydride oleanane (CHEBI:36481) |
| 3,21-dioxoolean-18-en-28-oic acid (CHEBI:65798) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| 3,21-dioxoolean-18-en-28-oic acid (CHEBI:65798) has role metabolite (CHEBI:25212) |
| 3,21-dioxoolean-18-en-28-oic acid (CHEBI:65798) is a dioxo monocarboxylic acid (CHEBI:35951) |
| 3,21-dioxoolean-18-en-28-oic acid (CHEBI:65798) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 3,21-dioxoolean-18-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9026662 | Reaxys |
| Citations |
|---|