EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H58O5 |
| Net Charge | 0 |
| Average Mass | 642.921 |
| Monoisotopic Mass | 642.42842 |
| SMILES | [H][C@]1(/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)C=C=C2C(C)(C)C[C@H](OC(C)=O)C[C@@]2(C)O)C=C2C(C)(C)C[C@H](O)C[C@@]2(C)O1 |
| InChI | InChI=1S/C42H58O5/c1-29(18-14-19-31(3)22-23-37-40(8,9)27-35(46-33(5)43)28-41(37,10)45)16-12-13-17-30(2)20-15-21-32(4)36-24-38-39(6,7)25-34(44)26-42(38,11)47-36/h12-22,24,34-36,44-45H,25-28H2,1-11H3/b13-12+,18-14+,20-15+,29-16+,30-17+,31-19+,32-21+/t23-,34-,35-,36+,41+,42+/m0/s1 |
| InChIKey | KXMXJSVCINTGDB-KQKVKUFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Peridinium bipes (ncbitaxon:2868) | - | PubMed (12499607) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dinochrome A (CHEBI:65797) has role antineoplastic agent (CHEBI:35610) |
| dinochrome A (CHEBI:65797) has role metabolite (CHEBI:25212) |
| dinochrome A (CHEBI:65797) is a acetate ester (CHEBI:47622) |
| dinochrome A (CHEBI:65797) is a allenes (CHEBI:37602) |
| dinochrome A (CHEBI:65797) is a carotenoid (CHEBI:23044) |
| dinochrome A (CHEBI:65797) is a cyclic ether (CHEBI:37407) |
| dinochrome A (CHEBI:65797) is a secondary alcohol (CHEBI:35681) |
| dinochrome A (CHEBI:65797) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3S,3'S,5R,5'R,6'R,8R,8'R,9cis)-3,5'-dihydroxy-6,7'-didehydro-5,5',6,8-tetrahydro-5,8-epoxy-β,β-caroten-3'-yl acetate |
| Synonym | Source |
|---|---|
| (3S,5R,6R,3'S,5'R,8'R)-5',8'-epoxy-6,7-didehydro-5,6,5',8'-tetrahydro-β,β- carotene-3,5,39-triol 3-O-acetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8207673 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9311649 | Reaxys |
| Citations |
|---|