EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O7 |
| Net Charge | 0 |
| Average Mass | 412.438 |
| Monoisotopic Mass | 412.15220 |
| SMILES | [H][C@@]1(c2ccc3c(c2)OCO3)CC(=O)c2c(OC)cc(OC)c(C[C@H](O)C(=C)C)c2O1 |
| InChI | InChI=1S/C23H24O7/c1-12(2)15(24)8-14-19(26-3)10-21(27-4)22-16(25)9-18(30-23(14)22)13-5-6-17-20(7-13)29-11-28-17/h5-7,10,15,18,24H,1,8-9,11H2,2-4H3/t15-,18-/m0/s1 |
| InChIKey | HEQLSVWMTJXPGS-YJBOKZPZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pongamia pinnata (ncbitaxon:56065) | stem (BTO:0001300) | PubMed (14510596) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-5,7-dimethoxy-8-(2S-hydroxy-3-methyl-3-butenyl)-3',4'-methylenedioxyflavanone (CHEBI:65796) has role antineoplastic agent (CHEBI:35610) |
| (2S)-5,7-dimethoxy-8-(2S-hydroxy-3-methyl-3-butenyl)-3',4'-methylenedioxyflavanone (CHEBI:65796) has role metabolite (CHEBI:25212) |
| (2S)-5,7-dimethoxy-8-(2S-hydroxy-3-methyl-3-butenyl)-3',4'-methylenedioxyflavanone (CHEBI:65796) is a benzodioxoles (CHEBI:38298) |
| (2S)-5,7-dimethoxy-8-(2S-hydroxy-3-methyl-3-butenyl)-3',4'-methylenedioxyflavanone (CHEBI:65796) is a dimethoxyflavanone (CHEBI:38743) |
| (2S)-5,7-dimethoxy-8-(2S-hydroxy-3-methyl-3-butenyl)-3',4'-methylenedioxyflavanone (CHEBI:65796) is a extended flavonoid (CHEBI:71037) |
| (2S)-5,7-dimethoxy-8-(2S-hydroxy-3-methyl-3-butenyl)-3',4'-methylenedioxyflavanone (CHEBI:65796) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2S)-2-(1,3-benzodioxol-5-yl)-8-[(2S)-2-hydroxy-3-methylbut-3-en-1-yl]-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9813791 | Reaxys |
| Citations |
|---|