EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O5 |
| Net Charge | 0 |
| Average Mass | 312.321 |
| Monoisotopic Mass | 312.09977 |
| SMILES | COc1cc(OC)c2c(c1C=O)O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C18H16O5/c1-21-15-9-16(22-2)17-13(20)8-14(11-6-4-3-5-7-11)23-18(17)12(15)10-19/h3-7,9-10,14H,8H2,1-2H3/t14-/m0/s1 |
| InChIKey | FHKQMPVRIQJSEJ-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pongamia pinnata (ncbitaxon:56065) | stem (BTO:0001300) | PubMed (14510596) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-5,7-dimethoxy-8-formylflavanone (CHEBI:65795) has role antineoplastic agent (CHEBI:35610) |
| (2S)-5,7-dimethoxy-8-formylflavanone (CHEBI:65795) has role metabolite (CHEBI:25212) |
| (2S)-5,7-dimethoxy-8-formylflavanone (CHEBI:65795) is a aldehyde (CHEBI:17478) |
| (2S)-5,7-dimethoxy-8-formylflavanone (CHEBI:65795) is a dimethoxyflavanone (CHEBI:38743) |
| IUPAC Name |
|---|
| (2S)-5,7-dimethoxy-4-oxo-2-phenyl-3,4-dihydro-2H-chromene-8-carbaldehyde |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9786124 | Reaxys |
| Citations |
|---|