EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H32O15 |
| Net Charge | 0 |
| Average Mass | 704.637 |
| Monoisotopic Mass | 704.17412 |
| SMILES | [H][C@@]12C[C@@](c3ccc(O)c(O)c3)(Oc3cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)c31)Oc1cc(O)c3c(c12)O[C@@]([H])(c1ccc(O)cc1)CC3=O |
| InChI | InChI=1S/C36H32O15/c37-13-27-31(44)32(45)33(46)35(49-27)47-17-8-21(41)28-18-12-36(50-25(28)9-17,15-3-6-19(39)20(40)7-15)51-26-11-23(43)30-22(42)10-24(48-34(30)29(18)26)14-1-4-16(38)5-2-14/h1-9,11,18,24,27,31-33,35,37-41,43-46H,10,12-13H2/t18-,24-,27-,31-,32+,33-,35-,36-/m1/s1 |
| InChIKey | FTKAVFCYTQUGTN-BNDLDUQUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarcophyte piriei (IPNI:103399-1) | - | PubMed (8786365) | A parasitic plant that grows on the root of Acacia species |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diinsinin (CHEBI:65793) has role anti-inflammatory agent (CHEBI:67079) |
| diinsinin (CHEBI:65793) has role metabolite (CHEBI:25212) |
| diinsinin (CHEBI:65793) is a biflavonoid (CHEBI:50128) |
| diinsinin (CHEBI:65793) is a hydroxyflavonoid (CHEBI:71968) |
| diinsinin (CHEBI:65793) is a monosaccharide derivative (CHEBI:63367) |
| diinsinin (CHEBI:65793) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (2R,8R,14R)-8-(3,4-dihydroxyphenyl)-5,13-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H,14H-8,14-methanochromeno[7,8-d][1,3]benzodioxocin-11-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 5,7,3',4'-tetrahydroxyflavanyl-7-O-β-glucosyl-(4β-8;2β-O-7)-naringenin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:176739-80-3 | ChemIDplus |
| Citations |
|---|