EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O4 |
| Net Charge | 0 |
| Average Mass | 256.257 |
| Monoisotopic Mass | 256.07356 |
| SMILES | O=C1CC(c2ccccc2)Oc2c1ccc(O)c2O |
| InChI | InChI=1S/C15H12O4/c16-11-7-6-10-12(17)8-13(19-15(10)14(11)18)9-4-2-1-3-5-9/h1-7,13,16,18H,8H2 |
| InChIKey | OXEDXEXEXGPMOG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia katsumadai (IPNI:871977-1) | seed (BTO:0001226) | PubMed (14577694) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-dihydroxyflavanone (CHEBI:65787) has role antineoplastic agent (CHEBI:35610) |
| 7,8-dihydroxyflavanone (CHEBI:65787) has role metabolite (CHEBI:25212) |
| 7,8-dihydroxyflavanone (CHEBI:65787) is a dihydroxyflavanone (CHEBI:38749) |
| IUPAC Name |
|---|
| 7,8-dihydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Manual Xrefs | Databases |
|---|---|
| 21375590 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:233694 | Reaxys |
| Citations |
|---|