EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O4S |
| Net Charge | 0 |
| Average Mass | 278.329 |
| Monoisotopic Mass | 278.06128 |
| SMILES | O=S(=O)(Cc1ccc(O)cc1)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H14O4S/c15-13-5-1-11(2-6-13)9-19(17,18)10-12-3-7-14(16)8-4-12/h1-8,15-16H,9-10H2 |
| InChIKey | JFHSUEXVHAPNCF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gastrodia elata (ncbitaxon:91201) | tuber (BTO:0001400) | PubMed (15180301) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4'-dihydroxybenzyl sulfone (CHEBI:65786) has role metabolite (CHEBI:25212) |
| 4,4'-dihydroxybenzyl sulfone (CHEBI:65786) has role platelet aggregation inhibitor (CHEBI:50427) |
| 4,4'-dihydroxybenzyl sulfone (CHEBI:65786) is a phenols (CHEBI:33853) |
| 4,4'-dihydroxybenzyl sulfone (CHEBI:65786) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 4,4'-(sulfonyldimethanediyl)diphenol |
| Citations |
|---|