EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O4 |
| Net Charge | 0 |
| Average Mass | 248.278 |
| Monoisotopic Mass | 248.10486 |
| SMILES | CC(C)=CCc1cc(/C=C/C(=O)O)cc(O)c1O |
| InChI | InChI=1S/C14H16O4/c1-9(2)3-5-11-7-10(4-6-13(16)17)8-12(15)14(11)18/h3-4,6-8,15,18H,5H2,1-2H3,(H,16,17)/b6-4+ |
| InChIKey | JVQIELYQOZIVPK-GQCTYLIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brazilian propolis | - | DOI (10.1248/cpb.47.1521) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydroxy-5-prenylcinnamic acid (CHEBI:65784) has functional parent trans-caffeic acid (CHEBI:16433) |
| 3,4-dihydroxy-5-prenylcinnamic acid (CHEBI:65784) has role antioxidant (CHEBI:22586) |
| 3,4-dihydroxy-5-prenylcinnamic acid (CHEBI:65784) has role metabolite (CHEBI:25212) |
| 3,4-dihydroxy-5-prenylcinnamic acid (CHEBI:65784) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (2E)-3-[3,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]prop-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8495042 | Reaxys |