EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65782 - 3β,12-dihydroxy-13-methyl-6,8,11,13-podocarpatetraene
| Formula | C18H24O2 |
| Net Charge | 0 |
| Average Mass | 272.388 |
| Monoisotopic Mass | 272.17763 |
| SMILES | [H][C@@]12C=Cc3cc(C)c(O)cc3[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C18H24O2/c1-11-9-12-5-6-15-17(2,3)16(20)7-8-18(15,4)13(12)10-14(11)19/h5-6,9-10,15-16,19-20H,7-8H2,1-4H3/t15-,16-,18+/m0/s1 |
| InChIKey | SJWBGJZSWLEJSB-XYJFISCASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Securinega suffruticosa (ncbitaxon:544674) | callus (BTO:0001010) | PubMed (16327202) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β,12-dihydroxy-13-methyl-6,8,11,13-podocarpatetraene (CHEBI:65782) has parent hydride podocarpane (CHEBI:36548) |
| 3β,12-dihydroxy-13-methyl-6,8,11,13-podocarpatetraene (CHEBI:65782) has role antineoplastic agent (CHEBI:35610) |
| 3β,12-dihydroxy-13-methyl-6,8,11,13-podocarpatetraene (CHEBI:65782) has role metabolite (CHEBI:25212) |
| 3β,12-dihydroxy-13-methyl-6,8,11,13-podocarpatetraene (CHEBI:65782) is a diterpenoid (CHEBI:23849) |
| 3β,12-dihydroxy-13-methyl-6,8,11,13-podocarpatetraene (CHEBI:65782) is a phenols (CHEBI:33853) |
| 3β,12-dihydroxy-13-methyl-6,8,11,13-podocarpatetraene (CHEBI:65782) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3β)-13-methylpodocarpa-6,8,11,13-tetraene-3,12-diol |
| Manual Xrefs | Databases |
|---|---|
| 9819493 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10272584 | Reaxys |
| Citations |
|---|