EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O4S |
| Net Charge | 0 |
| Average Mass | 202.231 |
| Monoisotopic Mass | 202.02998 |
| SMILES | CS(=O)c1cc(O)cc(CO)c1O |
| InChI | InChI=1S/C8H10O4S/c1-13(12)7-3-6(10)2-5(4-9)8(7)11/h2-3,9-11H,4H2,1H3 |
| InChIKey | NADRVFUNXRGAII-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ampelomyces (ncbitaxon:50729) | - | PubMed (18603789) | Strain: SC0307 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dihydroxy-3-methanesulfinylbenzyl alcohol (CHEBI:65779) has role antibacterial agent (CHEBI:33282) |
| 2,5-dihydroxy-3-methanesulfinylbenzyl alcohol (CHEBI:65779) has role metabolite (CHEBI:25212) |
| 2,5-dihydroxy-3-methanesulfinylbenzyl alcohol (CHEBI:65779) is a benzyl alcohols (CHEBI:22743) |
| 2,5-dihydroxy-3-methanesulfinylbenzyl alcohol (CHEBI:65779) is a hydroquinones (CHEBI:24646) |
| 2,5-dihydroxy-3-methanesulfinylbenzyl alcohol (CHEBI:65779) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 2-(hydroxymethyl)-6-(methylsulfinyl)benzene-1,4-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18590032 | Reaxys |
| Citations |
|---|