EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@@](CC[C@@]4([H])[C@@]3(C)CCC[C@@]4(C)C(=O)O)(C1)C[C@@]2(O)CO |
| InChI | InChI=1S/C20H32O4/c1-17-7-3-8-18(2,16(22)23)14(17)6-9-19-10-13(4-5-15(17)19)20(24,11-19)12-21/h13-15,21,24H,3-12H2,1-2H3,(H,22,23)/t13-,14+,15+,17-,18-,19+,20-/m1/s1 |
| InChIKey | MRBLTWPEPGRXQN-WMUQSPHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annona reticulata (ncbitaxon:301862) | stem (BTO:0001300) | DOI (10.1021/np50053a043) | Previous component: stem bark; |
| Annona squamosa (ncbitaxon:301693) | fruit (BTO:0000486) | PubMed (8786370) | Fresh fruit |
| Helianthus (ncbitaxon:4231) | - | DOI (10.1016/S0031-9422(00)80485-9) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16β,17-dihydroxy-ent-kaurane-19-oic acid (CHEBI:65778) has role anti-HIV agent (CHEBI:64946) |
| 16β,17-dihydroxy-ent-kaurane-19-oic acid (CHEBI:65778) has role metabolite (CHEBI:25212) |
| 16β,17-dihydroxy-ent-kaurane-19-oic acid (CHEBI:65778) is a ent-kaurane diterpenoid (CHEBI:36760) |
| 16β,17-dihydroxy-ent-kaurane-19-oic acid (CHEBI:65778) is a bridged compound (CHEBI:35990) |
| 16β,17-dihydroxy-ent-kaurane-19-oic acid (CHEBI:65778) is a diol (CHEBI:23824) |
| 16β,17-dihydroxy-ent-kaurane-19-oic acid (CHEBI:65778) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 16β,17-dihydroxy-ent-kaurane-19-oic acid (CHEBI:65778) is a primary alcohol (CHEBI:15734) |
| 16β,17-dihydroxy-ent-kaurane-19-oic acid (CHEBI:65778) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (5β,8α,9β,10α)-16,17-dihydroxykauran-18-oic acid |
| Synonym | Source |
|---|---|
| 16β,17-dihydroxy-ent-kaurane-19-oic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5382270 | Reaxys |
| Citations |
|---|