EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@]12C[C@@](C)(O)CCC1=C(CO)CC[C@@H]2C(C)C |
| InChI | InChI=1S/C15H26O2/c1-10(2)12-5-4-11(9-16)13-6-7-15(3,17)8-14(12)13/h10,12,14,16-17H,4-9H2,1-3H3/t12-,14-,15+/m1/s1 |
| InChIKey | AEIGTUFAPRNEKB-YUELXQCFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tyromyces chioneus (ncbitaxon:83250) | - | PubMed (17551214) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4β,14-dihydroxy-6α,7β-H-1(10)-cadinene (CHEBI:65776) has role anti-HIV-1 agent (CHEBI:64947) |
| 4β,14-dihydroxy-6α,7β-H-1(10)-cadinene (CHEBI:65776) has role metabolite (CHEBI:25212) |
| 4β,14-dihydroxy-6α,7β-H-1(10)-cadinene (CHEBI:65776) is a cadinane sesquiterpenoid (CHEBI:22975) |
| 4β,14-dihydroxy-6α,7β-H-1(10)-cadinene (CHEBI:65776) is a carbobicyclic compound (CHEBI:36785) |
| 4β,14-dihydroxy-6α,7β-H-1(10)-cadinene (CHEBI:65776) is a secondary alcohol (CHEBI:35681) |
| 4β,14-dihydroxy-6α,7β-H-1(10)-cadinene (CHEBI:65776) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2S,8R,8aR)-5-(hydroxymethyl)-2-methyl-8-(propan-2-yl)-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-ol |
| Citations |
|---|