EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H40O10 |
| Net Charge | 0 |
| Average Mass | 656.728 |
| Monoisotopic Mass | 656.26215 |
| SMILES | [H][C@]12C[C@H](OC(=O)c3ccccc3)[C@]3(COC(=O)c4ccccc4)[C@@H](O)[C@@H](OC(C)=O)C[C@@H](C)[C@@]3(OC1(C)C)[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H40O10/c1-23-20-29(45-24(2)39)31(40)37(22-44-33(41)25-14-8-5-9-15-25)30(46-34(42)26-16-10-6-11-17-26)21-28-32(38(23,37)48-36(28,3)4)47-35(43)27-18-12-7-13-19-27/h5-19,23,28-32,40H,20-22H2,1-4H3/t23-,28-,29+,30+,31+,32-,37-,38-/m1/s1 |
| InChIKey | ZKSJYLLIQBNONM-MYQHGJAJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microtropis fokienensis (ncbitaxon:1089417) | root (BTO:0001188) | PubMed (17315960) |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α-acetoxy-1α-hydroxy-6β,9β,15-tribenzoyloxy-β-dihydroagarofuran (CHEBI:65775) has role antitubercular agent (CHEBI:33231) |
| 2α-acetoxy-1α-hydroxy-6β,9β,15-tribenzoyloxy-β-dihydroagarofuran (CHEBI:65775) has role metabolite (CHEBI:25212) |
| 2α-acetoxy-1α-hydroxy-6β,9β,15-tribenzoyloxy-β-dihydroagarofuran (CHEBI:65775) is a acetate ester (CHEBI:47622) |
| 2α-acetoxy-1α-hydroxy-6β,9β,15-tribenzoyloxy-β-dihydroagarofuran (CHEBI:65775) is a benzoate ester (CHEBI:36054) |
| 2α-acetoxy-1α-hydroxy-6β,9β,15-tribenzoyloxy-β-dihydroagarofuran (CHEBI:65775) is a bridged compound (CHEBI:35990) |
| 2α-acetoxy-1α-hydroxy-6β,9β,15-tribenzoyloxy-β-dihydroagarofuran (CHEBI:65775) is a dihydroagarofuran sesquiterpenoid (CHEBI:71548) |
| 2α-acetoxy-1α-hydroxy-6β,9β,15-tribenzoyloxy-β-dihydroagarofuran (CHEBI:65775) is a organic heterotricyclic compound (CHEBI:26979) |
| 2α-acetoxy-1α-hydroxy-6β,9β,15-tribenzoyloxy-β-dihydroagarofuran (CHEBI:65775) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3R,5S,5aS,6R,7S,9R,9aS,10R)-7-(acetyloxy)-5a-[(benzoyloxy)methyl]-6-hydroxy-2,2,9-trimethyloctahydro-2H-3,9a-methano-1-benzoxepine-5,10-diyl dibenzoate |
| Synonym | Source |
|---|---|
| 2α-acetoxy-1α-hydroxy-6β,9β,15-tribenzoyloxy-β-dihydroagarofuran | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11042046 | Reaxys |
| Citations |
|---|