EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O4 |
| Net Charge | 0 |
| Average Mass | 364.526 |
| Monoisotopic Mass | 364.26136 |
| SMILES | CCCCCCCCCCCC/C=C/CC(=O)C1=C(O)CC(O)CC1=O |
| InChI | InChI=1S/C22H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(24)22-20(25)16-18(23)17-21(22)26/h13-14,18,23,25H,2-12,15-17H2,1H3/b14-13+ |
| InChIKey | YEFDDSMURKQPEL-BUHFOSPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Virola sebifera (ncbitaxon:224866) | leaf (BTO:0000713) | PubMed (17685388) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dihydroxy-2-(1'-oxo-3'-hexadecenyl)-2-cyclohexene-1-one (CHEBI:65773) has role antineoplastic agent (CHEBI:35610) |
| 3,5-dihydroxy-2-(1'-oxo-3'-hexadecenyl)-2-cyclohexene-1-one (CHEBI:65773) has role metabolite (CHEBI:25212) |
| 3,5-dihydroxy-2-(1'-oxo-3'-hexadecenyl)-2-cyclohexene-1-one (CHEBI:65773) is a enol (CHEBI:33823) |
| 3,5-dihydroxy-2-(1'-oxo-3'-hexadecenyl)-2-cyclohexene-1-one (CHEBI:65773) is a enone (CHEBI:51689) |
| 3,5-dihydroxy-2-(1'-oxo-3'-hexadecenyl)-2-cyclohexene-1-one (CHEBI:65773) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 2-[(3E)-hexadec-3-enoyl]-3,5-dihydroxycyclohex-2-en-1-one |
| Citations |
|---|