EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65769 - dieckol
| Formula | C36H22O18 |
| Net Charge | 0 |
| Average Mass | 742.554 |
| Monoisotopic Mass | 742.08061 |
| SMILES | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(Oc4c(O)cc(Oc5c(O)cc(O)c6c5Oc5c(O)cc(O)cc5O6)cc4O)cc2O3)c1 |
| InChI | InChI=1S/C36H22O18/c37-12-1-13(38)3-15(2-12)49-31-22(44)10-25(47)34-35(31)54-30-21(43)8-17(9-27(30)52-34)48-28-19(41)6-16(7-20(28)42)50-32-23(45)11-24(46)33-36(32)53-29-18(40)4-14(39)5-26(29)51-33/h1-11,37-47H |
| InChIKey | DRZQFGYIIYNNEC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ecklonia cava (ncbitaxon:105407) | - | PubMed (19201199) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Applications: | anticoagulant An agent that prevents blood clotting. hepatoprotective agent Any compound that is able to prevent damage to the liver. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dieckol (CHEBI:65769) has functional parent phloroglucinol (CHEBI:16204) |
| dieckol (CHEBI:65769) has role anticoagulant (CHEBI:50249) |
| dieckol (CHEBI:65769) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| dieckol (CHEBI:65769) has role hepatoprotective agent (CHEBI:62868) |
| dieckol (CHEBI:65769) has role metabolite (CHEBI:25212) |
| dieckol (CHEBI:65769) has role radical scavenger (CHEBI:48578) |
| dieckol (CHEBI:65769) is a aromatic ether (CHEBI:35618) |
| dieckol (CHEBI:65769) is a oxacycle (CHEBI:38104) |
| dieckol (CHEBI:65769) is a phlorotannin (CHEBI:71222) |
| IUPAC Name |
|---|
| 4-(4-{[6-(3,5-dihydroxyphenoxy)-4,7,9-trihydroxyoxanthren-2-yl]oxy}-3,5-dihydroxyphenoxy)oxanthrene-1,3,6,8-tetrol |
| Synonym | Source |
|---|---|
| 4-[4-[[6-(3,5-dihydroxyphenoxy)-4,7,9-trihydroxydibenzo[b,e][1,4]dioxin-2-yl]oxy]-3,5-dihydroxyphenoxy]-dibenzo[b,e][1,4]dioxin-1,3,6,8-tetrol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Dieckol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5714171 | Reaxys |
| Citations |
|---|